HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,2-Dimethyl-n-[3-(trifluoromethyl)phenyl]propanamide
3'-(TRIFLUOROMETHYL)PIVALANILIDE · 2,2-DIMETHYL-3'-(TRIFLUOROMETHYL)PROPIONANILIDE · 4,4,4-Trifluoro-2,2-dimethyl-N-phenylbutanamide · N-(2,2-Dimethylpropanoyl)-3-(trifluoromethyl)aniline · 2,2-DIMETHYL-N-[3-(TRIFLUOROMETHYL)PHENYL]-PROPANAMIDE · Propanamide, 2,2-dimethyl-N-[3-(trifluoromethyl)phenyl]-
![Molekülstruktur von 2,2-Dimethyl-n-[3-(trifluoromethyl)phenyl]propanamide](/img/chemical/714339.png)
Identifikatoren & physikalische Daten
| CAS No. | 1939-19-1 |
|---|---|
| Summenformel | C12H14F3NO |
| Durchschnittliche Molmasse | 245,24 g/mol |
| Monoisotopische Masse | 245,10274873 g/mol |
| SMILES | CC(C)(C)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChIKey | AGOPRFPFSYTJNX-UHFFFAOYSA-N |
| PubChem CID | 714339 |
| DTXSID | DTXSID10351934 |
Chemische & physikalische Eigenschaften
| XLogP | 4 |
|---|---|
| Polarare Oberfläche (TPSA) | 29,1 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 280 |
| Schmelzpunkt | 107 °C |
| Siedepunkt | 322.1±42.0 °C(Predicted) |
| Dichte | 1.192±0.06 g/cm3(Predicted) |
| Löslichkeit | Dichloromethane, Ethyl Acetate |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 14.58±0.70(Predicted) |
| Farbe | White |
Sicherheit & Vorschriften
| Zollcode | 2921420090 |
|---|---|
| Gefahrensymbole | Xi |
| hazard_note | Irritant |
Anwendungen & Verwendung
Verwenden
Intermediate for the preparation of Flunixin and other derivatives of this analgesic.