HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(4-Methylpiperazin-1-yl)(4-nitrophenyl)methanone
1-Methyl-4-[(4-nitrophenyl)carbonyl]piperazine · (4-Methylpiperazin-1-yl)(4-nitrophenyl)Methanone · (4-methyl-1-piperazinyl)(4-nitrophenyl)methanone · Methanone, (4-methyl-1-piperazinyl)(4-nitrophenyl)-
Identifikatoren & physikalische Daten
| CAS No. | 21091-98-5 |
|---|---|
| Summenformel | C12H15N3O3 |
| Durchschnittliche Molmasse | 249,27 g/mol |
| Monoisotopische Masse | 249,11134134 g/mol |
| SMILES | CN1CCN(C(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChIKey | UMRXCSPRJVBXHH-UHFFFAOYSA-N |
| PubChem CID | 716396 |
| DTXSID | DTXSID70352008 |
Chemische & physikalische Eigenschaften
| XLogP | 0,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 69,4 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 18 |
| Formalladung | 0 |
| Komplexität | 313 |
| Siedepunkt | 423.9±40.0 °C(Predicted) |
| Dichte | 1.262±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| pKa (Säurekonstante) | 6.59±0.10(Predicted) |
Sicherheit & Vorschriften
| Zollcode | 2933399990 |
|---|
Anwendungen & Verwendung
Verwenden
(4-Methylpiperazin-1-yl)(4-nitrophenyl)methanone is a useful reactant for interconversion of amide to thioamide using reusable MCM-41 mesoporous silica.