HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 71685607Erstellt: 2. November 2026
4-(Benzyloxy)oxane-4-carboxylic acid
4-(benzyloxy)oxane-4-carboxylic acid · 2H-Pyran-4-carboxylic acid, tetrahydro-4-(phenylmethoxy)-
https://huagongshe.com/de/chemical/71685607
Identifikatoren & physikalische Daten
| CAS No. | 1293265-45-8 |
|---|
| Summenformel | C13H16O4 |
|---|
| Durchschnittliche Molmasse | 236,26 g/mol |
|---|
| Monoisotopische Masse | 236,10485899 g/mol |
|---|
| SMILES | O=C(O)C1(OCc2ccccc2)CCOCC1 |
|---|
| InChIKey | OVBNUUMAZBAULI-UHFFFAOYSA-N |
|---|
| PubChem CID | 71685607 |
|---|
| EC No. | 865-589-6 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,4 |
|---|
| Polarare Oberfläche (TPSA) | 55,8 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 17 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 252 |
|---|
| Siedepunkt | 393.2±42.0 °C(Predicted) |
|---|
| Dichte | 1.21±0.1 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 3.41±0.20(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
