HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 720658Erstellt: 26. Oktober 2026
N-[4-(pyrrolidin-1-ylsulfonyl)phenyl]acetamide
N-[4-(pyrrolidin-1-ylsulfonyl)phenyl]acetamide · Acetamide, N-[4-(1-pyrrolidinylsulfonyl)phenyl]-
https://huagongshe.com/de/chemical/720658
Identifikatoren & physikalische Daten
| CAS No. | 288154-64-3 |
|---|
| Summenformel | C12H16N2O3S |
|---|
| Durchschnittliche Molmasse | 268,33 g/mol |
|---|
| Monoisotopische Masse | 268,08816337 g/mol |
|---|
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
|---|
| InChIKey | FAAZVYRDPYXYPO-UHFFFAOYSA-N |
|---|
| PubChem CID | 720658 |
|---|
| ChEMBL | CHEMBL1711547 |
|---|
| DTXSID | DTXSID00352172 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 0,7 |
|---|
| Polarare Oberfläche (TPSA) | 74,9 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 18 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 388 |
|---|
| Löslichkeit | >40.2 [ug/mL] (The mean of the results at pH 7.4) |
|---|
| Dichte | 1.340±0.06 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 14.36±0.70(Predicted) |
|---|
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
![Molekülstruktur von N-[4-(pyrrolidin-1-ylsulfonyl)phenyl]acetamide](/img/chemical/720658.png)