Identifikatoren & physikalische Daten
| CAS No. | 288154-73-4 |
|---|
| Summenformel | C17H19N3O3S |
|---|
| Durchschnittliche Molmasse | 345,4 g/mol |
|---|
| Monoisotopische Masse | 345,11471265 g/mol |
|---|
| SMILES | COc1ccc(C(=O)NNC(=S)NCc2ccccc2)cc1OC |
|---|
| InChIKey | ABBDYGNALLZFNP-UHFFFAOYSA-N |
|---|
| PubChem CID | 720694 |
|---|
| EC No. | 657-292-3 |
|---|
| DTXSID | DTXSID201149960 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,6 |
|---|
| Polarare Oberfläche (TPSA) | 104 |
|---|
| H-Brücken-Donoren | 3 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 5 |
|---|
| Schwere Atome | 24 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 416 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P273, P280, P301+P317, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P391, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
