HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 72244Erstellt: 3. November 2026
1-(4-Chlorobenzoyl)-1,2-dihydro-2-quinolinecarbonitrile
1-(4-chlorobenzoyl)-1,2-dihydro-2-quinolinecarbonitrile
https://huagongshe.com/de/chemical/72244
Identifikatoren & physikalische Daten
| CAS No. | 123742-98-3 |
|---|
| Summenformel | C17H11ClN2O |
|---|
| Durchschnittliche Molmasse | 294,7 g/mol |
|---|
| Monoisotopische Masse | 294,0559907 g/mol |
|---|
| SMILES | N#CC1C=Cc2ccccc2N1C(=O)c1ccc(Cl)cc1 |
|---|
| InChIKey | LUVKPKVQLSIRFM-UHFFFAOYSA-N |
|---|
| PubChem CID | 72244 |
|---|
| EC No. | 668-113-3 |
|---|
| DTXSID | DTXSID50915453 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,9 |
|---|
| Polarare Oberfläche (TPSA) | 44,1 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 2 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 21 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 472 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P273, P301+P317, P330, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
