HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-Deoxymannojirimycin
LU-1 · 1-Deoxymannojirimycin · DMJ · Antibiotic LU-1 · DEOXYMANNOJIRIMYCIN · 1,5-Dideoxy-1,5-imino-D-mannitol · 1,5-Dideoxy-1,5-epimino-D-mannitol · Deoxymannojirimycin, D-manno-Deoxynojirimycin
Identifikatoren & physikalische Daten
| CAS No. | 84444-90-6 |
|---|---|
| Summenformel | C6H13NO4 |
| Durchschnittliche Molmasse | 163,17 g/mol |
| Monoisotopische Masse | 163,0844579 g/mol |
| SMILES | OC[C@H]1NC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChIKey | LXBIFEVIBLOUGU-KVTDHHQDSA-N |
| PubChem CID | 72258 |
| ChEMBL | CHEMBL84844 |
Chemische & physikalische Eigenschaften
| XLogP | -2,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 93 |
| H-Brücken-Donoren | 5 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 132 |
| Arzneimittel | Pharmaceuticals -> Antibiotics |
| Schmelzpunkt | 164-167 °C |
| Siedepunkt | 361.1±42.0 °C(Predicted) |
| Dichte | 1.456±0.06 g/cm3(Predicted) |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | ethanol: 1mg/mLwater: 1mg/mL |
| pKa (Säurekonstante) | 13.77±0.70(Predicted) |
| Aggregatzustand | crystalline solid |
| Farbe | white |
| InChI | 1S/C6H13NO4/c8-2-3-5(10)6(11)4(9)1-7-3/h3-11H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| InChIKey | LXBIFEVIBLOUGU-KVTDHHQDSA-N |
Sicherheit & Vorschriften
| Regulatorische Informationen | 3,4,5-Piperidinetriol, 2-(hydroxymethyl)-, (2R,3R,4R,5R)-: Does not have an individual approval but may be used under an appropriate group standard |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| R-Sätze (R) | 20/21/22 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 36 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
competitive inhibitor of glucosidase I and II; pig kidney trehalase inhibitor