HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-((3S,8S)-1,2,3,4,5,6,7,8-Octahydro-3,8-dimethylazulen-5-yl)propan-2-ol
GUAIOL · Gualol · Champacol · Champaeol · Nsc 19941 · GUAIOL(RG) · (-)-GUAIOL · (?)-Guaiol
Identifikatoren & physikalische Daten
| CAS No. | 489-86-1 |
|---|---|
| Summenformel | C15H26O |
| Durchschnittliche Molmasse | 222,37 g/mol |
| Monoisotopische Masse | 222,19836545 g/mol |
| SMILES | C[C@@H]1CC[C@H](C(C)(C)O)CC2=C1CC[C@H]2C |
| InChIKey | TWVJWDMOZJXUID-UTUOFQBUSA-N |
| PubChem CID | 72607 |
| Lokaler Name | 2-((3S,8S)-1,2,3,4,5,6,7,8-Octahydro-3,8-dimethylazulen-5-yl)propan-2-ol |
Chemische & physikalische Eigenschaften
| XLogP | 3,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 20,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 16 |
| Formalladung | 0 |
| Komplexität | 301 |
| Schmelzpunkt | 91-93 °C(lit.) |
| Siedepunkt | 132-136℃ |
| Dichte | 0.9714 g/cm3 (20℃) |
| Brechungsindex | 1.5100 (589.3 nm 20℃) |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Chloroform (Slightly), Dichloromethane (Sparingly), Ethanol (Slightly), Methanol |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 15.11±0.29(Predicted) |
| Farbe | White to Off-White |
| Geruch | at 100.00 %. mild guaiacwood tea rose |
| Geruchsart | woody |
| Merck | 13,4572 |
| BRN | 2047993 |
| Hauptanwendungen | food and beverages |
| Kosmetik-Inhaltsstoffe Funktionen | PERFUMING |
| InChI | 1S/C15H26O/c1-10-5-7-12(15(3,4)16)9-14-11(2)6-8-13(10)14/h10-12,16H,5-9H2,1-4H3/t10-,11-,12+/m0/s1 |
| InChIKey | TWVJWDMOZJXUID-SDDRHHMPSA-N |
| SMILES | C[C@H]1CC[C@H](CC2=C1CC[C@@H]2C)C(C)(C)O |
| LogP (Verteilungskoeffizient) | 4.782 (est) |
| EPA chemische Informationen | 5-Azulenemethanol, 1,2,3,4,5,6,7,8-octahydro-.alpha.,.alpha.,3,8-tetramethyl-, (3S,5R,8S)- (489-86-1) |
Sicherheit & Vorschriften
| Regulatorische Informationen | Chemical: 5-Azulenemethanol, 1,2,3,4,5,6,7,8-octahydro-.alpha.,.alpha.,3,8-tetramethyl-, [3S-(3.alpha.,5.alpha.,8.alpha.)]- |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Sicherheitshinweise (S) | 22-24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
Guaiol is a component of guaiac wood oil, terpenol also found in cannabis.