Identifikatoren & physikalische Daten
| CAS No. | 301307-07-3 |
|---|
| Summenformel | C16H15NO3 |
|---|
| Durchschnittliche Molmasse | 269,29 g/mol |
|---|
| Monoisotopische Masse | 269,10519334 g/mol |
|---|
| SMILES | O=C(Cc1ccccc1)Nc1ccc2c(c1)OCCO2 |
|---|
| InChIKey | IZVXDKGYEUHJBT-UHFFFAOYSA-N |
|---|
| PubChem CID | 727596 |
|---|
| EC No. | 144-518-6 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|
| Polarare Oberfläche (TPSA) | 47,6 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 20 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 328 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P273, P301+P317, P330, P391, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
