HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
7-Bromobenz(a)anthracene
7-Bromotetraphene · Bromobenzanthracene · 7-bromobenzanthracene · 7-BROMOBENZ[A]ANTHRACENE · 7-bromo-benz(a)anthracen · 10-brom-1,2-benzanthracen · 7-bromobenzo[a]anthracene · 10-bromo-1,2-benzanthracene
Identifikatoren & physikalische Daten
| CAS No. | 32795-84-9 |
|---|---|
| Summenformel | C18H11Br |
| Durchschnittliche Molmasse | 307,2 g/mol |
| Monoisotopische Masse | 306,00441 g/mol |
| SMILES | Brc1c2ccccc2cc2c1ccc1ccccc12 |
| InChIKey | LGRNWCDRODWMOH-UHFFFAOYSA-N |
| PubChem CID | 72849 |
| EC No. | 621-169-2 |
| DTXSID | DTXSID70186461 |
Chemische & physikalische Eigenschaften
| XLogP | 6,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 19 |
| Formalladung | 0 |
| Komplexität | 326 |
| Schmelzpunkt | 152 °C |
| Siedepunkt | 361.79°C (rough estimate) |
| Dichte | 1.3995 (rough estimate) |
| Brechungsindex | 1.6000 (estimate) |
| Lagerbedingungen | Room Temperature, under inert atmosphere |
| Löslichkeit | Chloroform (Slightly), Dichloromethane (Slightly) |
| Aggregatzustand | Solid |
| Farbe | Light Beige to Dark Yellow |
| InChI | InChI=1S/C18H11Br/c19-18-15-8-4-2-6-13(15)11-17-14-7-3-1-5-12(14)9-10-16(17)18/h1-11H |
| InChIKey | LGRNWCDRODWMOH-UHFFFAOYSA-N |
| SMILES | C12=CC=CC=C1C=CC1C2=CC2C(=CC=CC=2)C=1Br |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P273, P280, P301+P317, P305+P351+P338, P330, P337+P317, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Zollcode | 2903.99.8001 |
| RTECS-Nr. | CW0180000 |
Anwendungen & Verwendung
Verwenden
7-Bromobenzo[A]anthracene is an organic synthesis intermediate, particularly used in the pharmaceutical and fine chemical industries to construct complex aromatic compounds.