HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Lup-20(29)-en-3-ol, (3β)-
Lupenol · FAGARASTEROL · Lupe · LUPEOL · Lupinol · Clerodol · B-VISCOL · MONOGYNOL
Identifikatoren & physikalische Daten
| CAS No. | 545-47-1 |
|---|---|
| Summenformel | C30H50O |
| Durchschnittliche Molmasse | 426,7 g/mol |
| Monoisotopische Masse | 426,38616621 g/mol |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)CCC3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| InChIKey | MQYXUWHLBZFQQO-JGGBMTAGSA-N |
| PubChem CID | 73040 |
| Lokaler Name | Lup-20(29)-en-3-ol, (3β)- |
Chemische & physikalische Eigenschaften
| XLogP | 9,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 20,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 31 |
| Formalladung | 0 |
| Komplexität | 766 |
| Schmelzpunkt | 215° |
| Siedepunkt | 482.1°C (rough estimate) |
| Dichte | 0.9457 |
| Brechungsindex | 1.4910 (estimate) |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly) |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 15.19±0.70(Predicted) |
| Farbe | White to Off-White |
| Kosmetik-Inhaltsstoffe Funktionen | SKIN CONDITIONING |
| InChIKey | MQYXUWHLBZFQQO-QGTGJCAVSA-N |
| SMILES | [H]C12CCC3C4(C)CCC(O)C(C)(C)[C@]4([H])CCC3(C)[C@]1(C)CCC5(C)CC[C@H](C(C)=C)[C@]25[H] |
| LogP (Verteilungskoeffizient) | 10.460 (est) |
| CAS Datenbank | 545-47-1(CAS DataBase Reference) |
| NIST chemische Informationen | Lupeol(545-47-1) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 2 |
|---|---|
| Zollcode | 29061990 |
| RTECS-Nr. | OK5763000 |
| Sicherheitshinweise (S) | 24/25 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrstoffdaten | 545-47-1(Hazardous Substances Data) |
| Gefahrenklasse | Acute Tox. 4 Oral |
Anwendungen & Verwendung
Verwenden
Lupeol was used as reference standard in method development and validation of lupeol from Vernonia Cinerea using HPLC method. It has been used as a standard for the identification and quantification of triterpenoids in blueberry cuticular wax by GC.