HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(4α)-3β-[[2-O-(6-Desoxy-α-L-mannopyranosyl)-α-L-arabinopyranosyl]oxy]-23-hydroxyolean-12-en-28-sure
HELIXIN · Hederoside B · Dipsacoside A · alpha-hederine · nepalin2 · A-HEDERIN · α-hederin · taurosidee
![Molekülstruktur von (4α)-3β-[[2-O-(6-Desoxy-α-L-mannopyranosyl)-α-L-arabinopyranosyl]oxy]-23-hydroxyolean-12-en-28-sure](/img/chemical/73296.png)
Identifikatoren & physikalische Daten
| CAS No. | 27013-91-8 |
|---|---|
| Summenformel | C41H66O12 |
| Durchschnittliche Molmasse | 751 g/mol |
| Monoisotopische Masse | 750,45542754 g/mol |
| SMILES | C[C@@H]1O[C@@H](O[C@H]2[C@H](O[C@H]3CC[C@@]4(C)[C@@H](CC[C@]5(C)[C@@H]4CC=C4[C@@H]6CC(C)(C)CC[C@]6(C(=O)O)CC[C@]45C)[C@]3(C)CO)OC[C@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChIKey | KEOITPILCOILGM-LLJOFIFVSA-N |
| PubChem CID | 73296 |
| ChEMBL | CHEMBL447565 |
| ChEBI | CHEBI:69370 |
| EC No. | 248-166-5 |
| DTXSID | DTXSID80909168 |
| Lokaler Name | (4α)-3β-[[2-O-(6-Desoxy-α-L-mannopyranosyl)-α-L-arabinopyranosyl]oxy]-23-hydroxyolean-12-en-28-sure |
Chemische & physikalische Eigenschaften
| XLogP | 3,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 196 |
| H-Brücken-Donoren | 7 |
| H-Brücken-Akzeptoren | 12 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 53 |
| Formalladung | 0 |
| Komplexität | 1.440 |
| Schmelzpunkt | 215°C (dec.) |
| Siedepunkt | 849.6±65.0 °C(Predicted) |
| Dichte | 1.32 |
| Lagerbedingungen | Sealed in dry,2-8°C |
| Löslichkeit | DMF: 10 mg/mlDMSO: 10 mg/mlEthanol: 5 mg/ml |
| pKa (Säurekonstante) | 4.63±0.70(Predicted) |
| Aggregatzustand | powder |
| Farbe | White-beige |
| Stabilität | Hygroscopic |
| InChIKey | KBKXVOJBOOKRQW-OGHMGUQHSA-N |
| LogP (Verteilungskoeffizient) | 8.370 (est) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | 1544 |
| Zollcode | 29389090 |
| RTECS-Nr. | RK0177800 |
| R-Sätze (R) | 22 |
| Sicherheitshinweise (S) | 22-45-24/25 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Acute Tox. 4 Oral |
Anwendungen & Verwendung
Verwenden
α-Hederin is a saponin of dry extracts from the leaves of Hedera helix L.Inhibitor of β2-adrenergic receptor-GFP fusion proteins. Potential cause for asphyxiation.