HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Fluor-6-nitrophenol
2-Fluoro-6-nitrophen · 2-Fluor-6-nitro-phenol · 6-FLUORO-2-NITROPHENOL · 2-FLUORO-6-NITROPHENOL · 2-NITRO-6-FLUORO PHENOL · fluoro-2 nitro-6 phenol · Phenol,2-fluoro-6-nitro- · Fluoro-6-nitrophenol, 2-
Identifikatoren & physikalische Daten
| CAS No. | 1526-17-6 |
|---|---|
| Summenformel | C6.H4.F.N.O3 |
| Durchschnittliche Molmasse | 157,1 g/mol |
| Monoisotopische Masse | 157,01752121 g/mol |
| SMILES | O=[N+]([O-])c1cccc(F)c1O |
| InChIKey | HIGRXCJEFUYRNW-UHFFFAOYSA-N |
| PubChem CID | 73710 |
| EC No. | 216-199-4 |
| DTXSID | DTXSID2075342 |
| Lokaler Name | 2-Fluor-6-nitrophenol |
Chemische & physikalische Eigenschaften
| XLogP | 1,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 66,1 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 158 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| Schmelzpunkt | 92-94°C |
| Siedepunkt | 201.5±20.0 °C(Predicted) |
| Dichte | 1.511±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| Löslichkeit | soluble in Methanol |
| Aggregatzustand | powder to crystal |
| pKa (Säurekonstante) | 5.67±0.24(Predicted) |
| Farbe | Light yellow to Yellow to Orange |
| BRN | 1870307 |
| InChI | InChI=1S/C6H4FNO3/c7-4-2-1-3-5(6(4)9)8(10)11/h1-3,9H |
| InChIKey | HIGRXCJEFUYRNW-UHFFFAOYSA-N |
| SMILES | C1(O)=C([N+]([O-])=O)C=CC=C1F |
| CAS Datenbank | 1526-17-6(CAS DataBase Reference) |
| EPA chemische Informationen | 2-Fluoro-6-nitrophenol (1526-17-6) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 6 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Protective Action Criteria (PAC) | 12 [mg/m3]130 [mg/m3]790 [mg/m3] |
| UN-Transportnummer | 2811 |
| Zollcode | 29089990 |
| R-Sätze (R) | 22-36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36/37/39-36/37 |
| Gefahrenklasse | IRRITANT |
| Verpackungsgruppe | III |
Anwendungen & Verwendung
Verwenden
2-Fluoro-6-nitrophenol has antifungal- and high plant-growth-regulating activity.