HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Trimethylphenoxysilan
PHENOXYTRIMETHYLSILANE · (Trimethylsiloxy)benzene · DK553 · DKSI224 · Phenol, TMS ether · Trimethylphenoxysilane · trimethylphenoxy-silan · TRIMETHYLSILYLPHENOXIDE
Identifikatoren & physikalische Daten
| CAS No. | 1529-17-5 |
|---|---|
| Summenformel | C9H14OSi |
| Durchschnittliche Molmasse | 166,29 g/mol |
| Monoisotopische Masse | 166,0813916 g/mol |
| SMILES | C[Si](C)(C)Oc1ccccc1 |
| InChIKey | OJAJJFGMKAZGRZ-UHFFFAOYSA-N |
| PubChem CID | 73720 |
| EC No. | 216-211-8 |
| DTXSID | DTXSID9061758 |
| Lokaler Name | Trimethylphenoxysilan |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 9,2 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 111 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| Schmelzpunkt | -55 °C |
| Siedepunkt | 81 °C23 mm Hg(lit.) |
| Dichte | 0.92 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.478 |
| Flammpunkt | 127 °F |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Aggregatzustand | liquid |
| Wichte | 0.92 |
| Farbe | Colorless to Light orange to Yellow |
| BRN | 1905943 |
| InChI | InChI=1S/C9H14OSi/c1-11(2,3)10-9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | OJAJJFGMKAZGRZ-UHFFFAOYSA-N |
| SMILES | C1(O[Si](C)(C)C)=CC=CC=C1 |
| EPA chemische Informationen | Silane, trimethylphenoxy- (1529-17-5) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| F | 10-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 1993 3/PG 3 |
| Zollcode | 29319090 |
| R-Sätze (R) | 10-36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36 |
| Gefahrenklasse | 3.2Eye Irrit. 2Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
Trimethyl(phenoxy)silane can be used as a catalyst for the Friedel-Crafts reaction, which is an organic reaction that converts alkenes into alcohols or epoxides. It can also reacts with hydrochloric acid to give phenol and chloroform. Trimethyl(phenoxy)silane has been shown to have chemical properties similar to those of phenol, such as viscosity, chemical species and resonance spectroscopy properties. It can react with oxygen in the air to form peroxides, so it should be stored in a cool, dry place away from light.