HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,4-Difluorbenzaldehyd
2,4-Difluorobenzalde · 2,4-fluorobenzaldehyde · 4-Difluorobenzaldehyde · 2,4-DIFLUOROBENZALDEHYDE · Benzaldehyde, 2,4-difluoro- · Of 2,4-difluorobenzaldehyde · 2,4-Difluorobenzaldehyde98% · 2,4-Difluorobenzaldehyde>2,4-DifluorobenzaldehydeQty
Identifikatoren & physikalische Daten
| CAS No. | 1550-35-2 |
|---|---|
| Summenformel | C7H4F2O |
| Durchschnittliche Molmasse | 142,1 g/mol |
| Monoisotopische Masse | 142,02302119 g/mol |
| SMILES | O=Cc1ccc(F)cc1F |
| InChIKey | WCGPCBACLBHDCI-UHFFFAOYSA-N |
| PubChem CID | 73770 |
| ChEMBL | CHEMBL4092237 |
| EC No. | 216-287-2 |
| DTXSID | DTXSID40165788 |
| Lokaler Name | 2,4-Difluorbenzaldehyd |
Chemische & physikalische Eigenschaften
| XLogP | 1,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 17,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 127 |
| Schmelzpunkt | 2-3 °C (lit.) |
| Siedepunkt | 65-66 °C/17 mmHg (lit.) |
| Dichte | 1.299 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.498(lit.) |
| Flammpunkt | 131 °F |
| Lagerbedingungen | Inert atmosphere,2-8°C |
| Aggregatzustand | Liquid |
| Wichte | 1.299 |
| Farbe | Clear colorless |
| BRN | 2243422 |
| InChI | InChI=1S/C7H4F2O/c8-6-2-1-5(4-10)7(9)3-6/h1-4H |
| InChIKey | WCGPCBACLBHDCI-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(F)C=C1F |
| CAS Datenbank | 1550-35-2(CAS DataBase Reference) |
| NIST chemische Informationen | 2,4-Difluorobenzaldehyde(1550-35-2) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| F | 10-23 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 1989 3/PG 3 |
| Zollcode | 29130000 |
| R-Sätze (R) | 10-36/37/38 |
| Gefahrensymbole | Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 26-36-37/39-16-36/37 |
| Gefahrenklasse | 3Eye Irrit. 2Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
2,4-Difluorobenzaldehyde was used in the synthesis of 3-benzylidene 20,29-dihydrobetulinic acid derivatives.