HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Brom-4-fluortoluol
2-BROMO-4-FLUORO-1-METHYLBENZENE · 2-Bromo-4-fluorotolu · CL027 · 2-Brom-4-fluortoluol · 2-Bromo-4-flurotoluene · 2-BROMO-4-FLUOROTOLUENE · 2-Bromo-4-fluorotoluene99% · 2-Bromo-4-fluorotoluene 99%
Identifikatoren & physikalische Daten
| CAS No. | 1422-53-3 |
|---|---|
| Summenformel | C7H6BrF |
| Durchschnittliche Molmasse | 189,02 g/mol |
| Monoisotopische Masse | 187,96369051 g/mol |
| SMILES | Cc1ccc(F)cc1Br |
| InChIKey | SFGFOJPGCOYQJK-UHFFFAOYSA-N |
| PubChem CID | 74016 |
| EC No. | 215-830-0 |
| DTXSID | DTXSID70161970 |
| Lokaler Name | 2-Brom-4-fluortoluol |
Chemische & physikalische Eigenschaften
| XLogP | 3,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 94,9 |
| Siedepunkt | 170-172 °C (lit.) |
| Dichte | 1.526 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.528(lit.) |
| Flammpunkt | 148 °F |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Aggregatzustand | liquid |
| Farbe | Clear, faint yellow/faint green |
| Wichte | 1.526 |
| BRN | 1859038 |
| InChI | InChI=1S/C7H6BrF/c1-5-2-3-6(9)4-7(5)8/h2-4H,1H3 |
| InChIKey | SFGFOJPGCOYQJK-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(F)C=C1Br |
| CAS Datenbank | 1422-53-3(CAS DataBase Reference) |
| NIST chemische Informationen | 2-Bromo-4-fluorotoluene(1422-53-3) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2810 |
| Zollcode | 29039990 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36/37/39-37/39 |
| Gefahrenklasse | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
2-Bromo-4-fluorotoluene may be used in the preparation of meta-fluoro analog, (tris(5-fluoro-2-methylphenyl)phosphane, F-TOTP).