HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Naphthalenemethanol
2-Naphtylmethanol · 2-Naphthylcarbinol · β-Naphthylcarbinol · b-Naphthylcarbinol · (2-Naphtyl)methanol · 2-NAPHTHYL METHANOL · RARECHEM AL BD 0094 · 2-phthalenemethanol
Identifikatoren & physikalische Daten
| CAS No. | 1592-38-7 |
|---|---|
| Summenformel | C11H10O |
| Durchschnittliche Molmasse | 158,2 g/mol |
| Monoisotopische Masse | 158,07316494 g/mol |
| SMILES | OCc1ccc2ccccc2c1 |
| InChIKey | MFGWMAAZYZSWMY-UHFFFAOYSA-N |
| PubChem CID | 74128 |
| ChEMBL | CHEMBL150445 |
| ChEBI | CHEBI:27615 |
| EC No. | 812-602-8 |
| DTXSID | DTXSID70166607 |
Chemische & physikalische Eigenschaften
| XLogP | 2,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 20,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 144 |
| LogP (Verteilungskoeffizient) | 2.42 |
| Schmelzpunkt | 79-81 °C (lit.) |
| Siedepunkt | 178°C/12mmHg(lit.) |
| Dichte | 0.9887 (rough estimate) |
| Brechungsindex | 1.5440 (estimate) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | Acetonitrile (Slightly), Chloroform (Slightly) |
| Aggregatzustand | Crystalline Powder |
| pKa (Säurekonstante) | 14.29±0.10(Predicted) |
| Farbe | White |
| InChI | InChI=1S/C11H10O/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7,12H,8H2 |
| InChIKey | MFGWMAAZYZSWMY-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC=C1CO |
| CAS Datenbank | 1592-38-7(CAS DataBase Reference) |
| NIST chemische Informationen | 2-Naphthalenemethanol(1592-38-7) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29062990 |
| R-Sätze (R) | 11-34 |
| Gefahrensymbole | Xi,C,F |
| Sicherheitshinweise (S) | 24/25-45-36/37/39-26-16 |
| Gefahrenklasse | IRRITANT |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2-Naphthalenemethanol was used as marker in the determination of critical micelle concentration of anionic surfactants by capillary electrophoresis. It was used in the synthesis of acetate protected xylosides.