HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
10-(3-Chlorpropyl)-2-(trifluormethyl)-10H-phenothiazin
Fluphenazine Dihydrochloride Impurity 15 · 2-TrifluoroMethyl-10-(3-chloropropyl)phenothiazine · 10-(3-Chloropropyl)-2-trifluoroMethylphenothiazine · 10-(3-Chloropropyl)-2-(trifluoroMethyl)-phenothiazine · 10-(3-chloropropyl)-2-(trifluoromethyl)-10H-phenothiazine · 10H-Phenothiazine, 10-(3-chloropropyl)-2-(trifluoromethyl)-
Identifikatoren & physikalische Daten
| CAS No. | 1675-46-3 |
|---|---|
| Summenformel | C16H13ClF3NS |
| Durchschnittliche Molmasse | 343,8 g/mol |
| Monoisotopische Masse | 343,0409328 g/mol |
| SMILES | FC(F)(F)c1ccc2c(c1)N(CCCCl)c1ccccc1S2 |
| InChIKey | BZEJZIAESDBOJX-UHFFFAOYSA-N |
| PubChem CID | 74294 |
| EC No. | 216-821-4 |
| DTXSID | DTXSID20168297 |
| Lokaler Name | 10-(3-Chlorpropyl)-2-(trifluormethyl)-10H-phenothiazin |
Chemische & physikalische Eigenschaften
| XLogP | 5,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 28,5 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 22 |
| Formalladung | 0 |
| Komplexität | 379 |
| Schmelzpunkt | 74-76°C |
| Lagerbedingungen | Refrigerator |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly) |
| Aggregatzustand | Solid |
| Farbe | White to Off-White |
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
Metabolite of Fluphenazine.