HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N,N-Diphenyl-N'-picrylhydrazin
2,2-Diphenyl-1-picrylhydrazine · Diphenylpicrylhydrazine · 1,1-DIPHENYL-2-PICRYLHYD · Hydrazine, diphenylpicryl- · 1,1-Diphenyl-2-picrylhydrazine · N,N-diphenyl-N'-picrylhydrazine · Hydrazine, 1,1-diphenyl-2-picryl- · 1,1-Diphenyl-2-picrylhydrazine 97%
Identifikatoren & physikalische Daten
| CAS No. | 1707-75-1 |
|---|---|
| Summenformel | C18H13N5O6 |
| Durchschnittliche Molmasse | 395,3 g/mol |
| Monoisotopische Masse | 395,08658314 g/mol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(NN(c2ccccc2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChIKey | WCBPJVKVIMMEQC-UHFFFAOYSA-N |
| PubChem CID | 74358 |
| EC No. | 216-953-2 |
| DTXSID | DTXSID8061896 |
| Lokaler Name | N,N-Diphenyl-N'-picrylhydrazin |
Chemische & physikalische Eigenschaften
| XLogP | 5,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 153 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 8 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 29 |
| Formalladung | 0 |
| Komplexität | 549 |
| Schmelzpunkt | ~174 °C (dec.)(lit.) |
| Siedepunkt | 530.2±60.0 °C(Predicted) |
| Dichte | 1.539±0.06 g/cm3(Predicted) |
| Löslichkeit | soluble in Chloroform |
| Aggregatzustand | powder to crystal |
| pKa (Säurekonstante) | -0.84±0.50(Predicted) |
| Farbe | Orange to Brown to Dark red |
| BRN | 770319 |
| InChI | InChI=1S/C18H13N5O6/c24-21(25)15-11-16(22(26)27)18(17(12-15)23(28)29)19-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,19H |
| InChIKey | WCBPJVKVIMMEQC-UHFFFAOYSA-N |
| SMILES | N(C1=CC=CC=C1)(C1=CC=CC=C1)NC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O |
| CAS Datenbank | 1707-75-1(CAS DataBase Reference) |
| EPA chemische Informationen | Hydrazine, 1,1-diphenyl-2-(2,4,6-trinitrophenyl)- (1707-75-1) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P271, P280, P301+P317, P302+P352, P304+P340, P317, P321, P330, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | 1325 |
| Zollcode | 29280000 |
| R-Sätze (R) | 20/21/22 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 36/37 |
| Gefahrenklasse | 4.1Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Resp. Sens. 1Self-react. CSkin Irrit. 2Skin Sens. 1 |
| Verpackungsgruppe | III |
| Lagerklasse | 4.1A - Other explosive hazardous materials |
Anwendungen & Verwendung
Verwenden
1,1-Diphenyl-2-picrylhydrazine has been known to show antioxidant and anticancer properties.