HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Glutathion
GSH · L-GLUTATHIONE REDUCED · REDUCED GLUTATHIONE · glutatione · Glutathion · Liposomal Glutathione · Glutathione powder · glutide
Identifikatoren & physikalische Daten
| CAS No. | 70-18-8 |
|---|---|
| Summenformel | C10H17N3O6S |
| Durchschnittliche Molmasse | 307,33 g/mol |
| Monoisotopische Masse | 307,08380626 g/mol |
| SMILES | NC(CCC(=O)NC(CS)C(=O)NCC(=O)O)C(=O)O |
| InChIKey | RWSXRVCMGQZWBV-UHFFFAOYSA-N |
| PubChem CID | 745 |
| ChEMBL | CHEMBL100476 |
| ChEBI | CHEBI:177535 |
| DTXSID | DTXSID70859082 |
| Lokaler Name | Glutathion |
Chemische & physikalische Eigenschaften
| XLogP | -4,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 160 |
| H-Brücken-Donoren | 6 |
| H-Brücken-Akzeptoren | 8 |
| Frei drehbare Bindungen | 9 |
| Schwere Atome | 20 |
| Formalladung | 0 |
| Komplexität | 389 |
| Schmelzpunkt | 192-195 °C (dec.) (lit.) |
| Siedepunkt | 754.5±60.0 °C(Predicted) |
| Dichte | 1.4482 (rough estimate) |
| Brechungsindex | -17 ° (C=2, H2O) |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | H2O: 50 mg/mLsoluble |
| Aggregatzustand | powder |
| pKa (Säurekonstante) | pK1 2.12pK2 3.53pK3 8.66pK4 9.12(at 25℃) |
| Farbe | White |
| pH | 3 (10g/l, H2O, 20°C) |
| Geruch | Odorless |
| Merck | 14,4475 |
| BRN | 1729812 |
| Stabilität | Stable. Incompatible with strong oxidizing agents. |
| Kosmetik-Inhaltsstoffe Funktionen | REDUCING |
| InChI | 1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
| InChIKey | RWSXRVCMGQZWBV-WDSKDSINSA-N |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O)C(O)=O |
| LogP (Verteilungskoeffizient) | -1.645 (est) |
| CAS Datenbank | 70-18-8(CAS DataBase Reference) |
| EPA chemische Informationen | Glutathione (70-18-8) |
Sicherheit & Vorschriften
| F | 9-23 |
|---|---|
| Wassergefährdungsklasse (WGK) | 2 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29309070 |
| RTECS-Nr. | MC0556000 |
| R-Sätze (R) | 68-36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 24/25-36/37/39-27-26 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Beschreibung
Glutathione (GSH) is a tripeptide (γ-glutamylcysteinylglycine) widely distributed in both plants and animals. GSH serves as a nucleophilic co-substrate to glutathione transferases in the detoxification of xenobiotics and is an essential electron donor to glutathione peroxidases in the reduction of hydroperoxides. GSH is also involved in amino acid transport and maintenance of protein sulfhydryl reduction status. The concentration of GSH ranges from a few micromolar in plasma to several millimolar in tissues such as liver.