HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,1,1,3,5,5,5-Heptamethyltrisiloxan
heptamethyltrisiloxane · MDHM · BIS(TRIMETHYLSILOXY)METHYLSILANE · 1,1,1,3,5,5,5-heptamethyl-trisiloxan · 40M25) · CFS-887 · Bis(trimethyL · Co-Formula CFS-887
Identifikatoren & physikalische Daten
| CAS No. | 1873-88-7 |
|---|---|
| Summenformel | C7H22O2Si3 |
| Durchschnittliche Molmasse | 222,5 g/mol |
| Monoisotopische Masse | 222,09275953 g/mol |
| SMILES | C[SiH](O[Si](C)(C)C)O[Si](C)(C)C |
| InChIKey | QNWOFLWXQGHSRH-UHFFFAOYSA-N |
| PubChem CID | 74640 |
| DTXSID | DTXSID1038795 |
| Lokaler Name | 1,1,1,3,5,5,5-Heptamethyltrisiloxan |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 18,5 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 121 |
| SpringerMaterials Properties | Chemical shift |
| Schmelzpunkt | <0°C |
| Siedepunkt | 142 °C (lit.) |
| Dichte | 0.819 g/mL at 25 °C (lit.) |
| Dampfdruck | 8.5hPa at 25℃ |
| Brechungsindex | n20/D 1.382(lit.) |
| Flammpunkt | 82 °F |
| Lagerbedingungen | 15-25°C |
| Löslichkeit | Chloroform (Soluble), Methanol (Slightly)Miscible with acetone, ethanol, diethyl ether. Insoluble in water. |
| Aggregatzustand | clear liquid |
| Wichte | 0.8136 |
| Farbe | Colorless to Almost colorless |
| BRN | 1748455 |
| Henry-Konstante | 1.1×10-7 mol/(m3Pa) at 25℃, Ebert et al. (2023) |
| Stabilität | Stable. Flammable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C7H22O2Si3/c1-10(8-11(2,3)4)9-12(5,6)7/h10H,1-7H3 |
| InChIKey | QNWOFLWXQGHSRH-UHFFFAOYSA-N |
| SMILES | C[SiH](O[Si](C)(C)C)O[Si](C)(C)C |
| LogP (Verteilungskoeffizient) | 6.2 at 20℃ |
| CAS Datenbank | 1873-88-7(CAS DataBase Reference) |
| NIST chemische Informationen | Trisiloxane, 1,1,1,3,5,5,5-heptamethyl-,(1873-88-7) |
| EPA chemische Informationen | Trisiloxane, 1,1,1,3,5,5,5-heptamethyl- (1873-88-7) |
Sicherheit & Vorschriften
| F | 10-21 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 1993 3/PG 2 |
| Zollcode | 29319090 |
| R-Sätze (R) | 10-36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36 |
| Gefahrenklasse | 3Eye Irrit. 2Flam. Liq. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | II |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Beschreibung
Bis (trimethylsiloxy) methylsilane acts as an important raw material and intermediate used in organic synthesis, pharmaceutical and dyestuff. For example, it can be used for the platinum-catalyzed aromatic C-H silylation of arenes. It can also be used for the silylation of aryl iodides.
Verwenden
1,1,1,3,5,5,5-Heptamethyltrisiloxane is a Basic material for synthetic polyalkyleneoxide modified heptamethyltrisiloxane which is a kind of specific structure surfactant for pesticide additives, coating additives, etc.