HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Methyl-5-nitrohydrogenisophthalat
3-(Methoxycarbonyl)-5-nitrobenzoic acid · 5-NITROISOPHTHALIC ACID MONOMETHYL ESTER · NITROISOPHTHALIC-5 ACID, MONOMETHYL ESTER · 5-NIPA-MME · 5-Nitroisophthalic · Adagrasib Impurity 62 · LABOTEST-BB LT00848268 · Methyl 5-nitroisophthalate
Identifikatoren & physikalische Daten
| CAS No. | 1955-46-0 |
|---|---|
| Summenformel | C9H7NO6 |
| Durchschnittliche Molmasse | 225,15 g/mol |
| Monoisotopische Masse | 225,02733694 g/mol |
| SMILES | COC(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1 |
| InChIKey | ZCRNIIJXDRYWDU-UHFFFAOYSA-N |
| PubChem CID | 74776 |
| EC No. | 217-793-6 |
| DTXSID | DTXSID50883784 |
| Lokaler Name | Methyl-5-nitrohydrogenisophthalat |
Chemische & physikalische Eigenschaften
| XLogP | 1,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 109 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 16 |
| Formalladung | 0 |
| Komplexität | 310 |
| Schmelzpunkt | 180-182 °C (lit.) |
| Siedepunkt | 366.65°C (rough estimate) |
| Dichte | 1.5322 (rough estimate) |
| Dampfdruck | 0-0Pa at 25℃ |
| Brechungsindex | 1.5200 (estimate) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | 9g/L in organic solvents at 20 ℃insoluble |
| Aggregatzustand | Fine Crystalline Powder |
| pKa (Säurekonstante) | 3.11±0.10(Predicted) |
| Farbe | Slightly yellow |
| BRN | 1469253 |
| InChI | 1S/C9H7NO6/c1-16-9(13)6-2-5(8(11)12)3-7(4-6)10(14)15/h2-4H,1H3,(H,11,12) |
| InChIKey | ZCRNIIJXDRYWDU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(cc(c1)[N+]([O-])=O)C(O)=O |
| LogP (Verteilungskoeffizient) | 1.65 at 25℃ |
| CAS Datenbank | 1955-46-0(CAS DataBase Reference) |
| EPA chemische Informationen | Monomethyl 5-nitroisophthalate (1955-46-0) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 2811 |
| Zollcode | 29173980 |
| R-Sätze (R) | 36/37/38-26/27/28 |
| Gefahrensymbole | T+ |
| Sicherheitshinweise (S) | 22-24/25-45-36/37/39 |
| Lagerklasse | 13 - Non Combustible Solids |
Anwendungen & Verwendung
Verwenden
Methyl 5-nitroisophthalate is used in the preparation of heterotrifunctional crosslinkers for multiple bioconjugation with peptides and also in the synthesis of histone demethylase LSD1 inhibitors tha t target cancer cells.