HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Bromopropanedial
BROMOMALONALDEHYDE · Bromomalonaldehyde 97% · 2-bromomalondialdehyde · onaL · BromomaL · 2-Bromomaloldehyde · 2-BROMOMALONALDEHYDE · Propanedial, 2-broMo-
Identifikatoren & physikalische Daten
| CAS No. | 2065-75-0 |
|---|---|
| Summenformel | C3H3BrO2 |
| Durchschnittliche Molmasse | 150,96 g/mol |
| Monoisotopische Masse | 149,93164 g/mol |
| SMILES | O=CC(Br)C=O |
| InChIKey | SURMYNZXHKLDFO-UHFFFAOYSA-N |
| PubChem CID | 74945 |
| EC No. | 430-470-6 |
| DTXSID | DTXSID60174690 |
Chemische & physikalische Eigenschaften
| XLogP | 0,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 34,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 6 |
| Formalladung | 0 |
| Komplexität | 53 |
| Schmelzpunkt | 132-136 °C(lit.) |
| Siedepunkt | 134.8±25.0 °C(Predicted) |
| Dichte | 1.750±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Inert atmosphere,Store in freezer, under -20°C |
| Löslichkeit | Acetonitrile (Slightly), DMSO (Slightly) |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 1.70±0.10(Predicted) |
| Farbe | Pale Beige to Pale Yellow |
| InChI | InChI=1S/C3H3BrO2/c4-3(1-5)2-6/h1-3H |
| InChIKey | SURMYNZXHKLDFO-UHFFFAOYSA-N |
| SMILES | C(=O)C(Br)C=O |
| CAS Datenbank | 2065-75-0(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29130000 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| hazard_note | Irritant/Keep Cold |
| Sicherheitshinweise (S) | 26-36 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Acute Tox. 4 OralEye Dam. 1 |
Anwendungen & Verwendung
Verwenden
Used in the formation of glyoxal-derived adducts from substituted guanines