HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Methyl-3-methyl-2-benzofurancarboxylat
methyl 3-methylbenzofuran-2-carboxylate · methyl 3-methyl-2-benzofurancarboxylate · methyl 3-methyl-1-benzofuran-2-carboxylate · 3-Methylbenzofuran-2-carboxylic acid methyl ester · 2-Benzofurancarboxylic acid, 3-methyl-, methyl ester · 3-methyl-1-isobenzofurancarboxylic acid methyl ester
Identifikatoren & physikalische Daten
| CAS No. | 2076-36-0 |
|---|---|
| Summenformel | C11H10O3 |
| Durchschnittliche Molmasse | 190,19 g/mol |
| Monoisotopische Masse | 190,06299418 g/mol |
| SMILES | COC(=O)c1oc2ccccc2c1C |
| InChIKey | HVUOTQOUAMXGLR-UHFFFAOYSA-N |
| PubChem CID | 74953 |
| EC No. | 218-198-4 |
| DTXSID | DTXSID40174830 |
| Lokaler Name | Methyl-3-methyl-2-benzofurancarboxylat |
Chemische & physikalische Eigenschaften
| XLogP | 2,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 39,4 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 227 |
| Schmelzpunkt | 69-70 °C |
| Siedepunkt | 130-135 °C(Press: 1 Torr) |
| Dichte | 1.184±0.06 g/cm3(Predicted) |
| Lagerbedingungen | 2-8°C |
| InChI | InChI=1S/C11H10O3/c1-7-8-5-3-4-6-9(8)14-10(7)11(12)13-2/h3-6H,1-2H3 |
| InChIKey | HVUOTQOUAMXGLR-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2C(C)=C1C(OC)=O |
Sicherheit & Vorschriften
| Zollcode | 2932990090 |
|---|
Anwendungen & Verwendung
Verwenden
3-Methylbenzofuran-2-carboxylic Acid Methyl Ester acts as a reagent in the synthesis and SAR of highly selective MMP-13 Inhibitors, preparation of saframycin analogs for the treatment of cancer.