HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Decansureanhydrid
CAPRIC ANHYDRIDE · ecanoyldecanoate · n-capricanhtdride · Decansureanhydrid · decanoyl decanoate · DECANOIC ANHYDRIDE · N-CAPRIC ANHYDRIDE · n-decylic anhydride
Identifikatoren & physikalische Daten
| CAS No. | 2082-76-0 |
|---|---|
| Summenformel | C20H38O3 |
| Durchschnittliche Molmasse | 326,5 g/mol |
| Monoisotopische Masse | 326,28209508 g/mol |
| SMILES | CCCCCCCCCC(=O)OC(=O)CCCCCCCCC |
| InChIKey | HTWWKYKIBSHDPC-UHFFFAOYSA-N |
| PubChem CID | 74960 |
| EC No. | 218-213-4 |
| DTXSID | DTXSID80174935 |
| Lokaler Name | Decansureanhydrid |
Chemische & physikalische Eigenschaften
| XLogP | 8,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 43,4 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 18 |
| Schwere Atome | 23 |
| Formalladung | 0 |
| Komplexität | 259 |
| Schmelzpunkt | 24-25 °C (lit.) |
| Siedepunkt | 125-140 °C/0.05 mmHg (lit.) |
| Dichte | 0.886 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.44(lit.) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | −20°C |
| Löslichkeit | chloroform: soluble100mg/mL, clear, colorless to light yellow |
| Aggregatzustand | Melting Solid |
| Farbe | Colorless to light yellow |
| InChI | 1S/C20H38O3/c1-3-5-7-9-11-13-15-17-19(21)23-20(22)18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3 |
| InChIKey | HTWWKYKIBSHDPC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OC(=O)CCCCCCCCC |
| CAS Datenbank | 2082-76-0(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P264+P265, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1C (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 3261 8/PG 2 |
| Zollcode | 29159000 |
| R-Sätze (R) | 34 |
| Gefahrensymbole | C |
| Sicherheitshinweise (S) | 26-27-36/37/39-45 |
| Gefahrenklasse | 8Eye Dam. 1Skin Corr. 1B |
| Verpackungsgruppe | III |
| Lagerklasse | 8A - Combustible corrosive hazardous materials |
Anwendungen & Verwendung
Verwenden
Decanoic anhydride was used in the synthesis of 2-deoxy-2-p-methoxybenzylimideneaminio-1,3,4,6-tetra-O-decanoyl-D-glucopyranose.