HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
DL-Glyceraldehyd
GLYCERALDEHYDE · glycerose · GLYCERIC ALDEHYDE · Propanal, 2,3-dihydroxy- · NSC 67934 · -PRO-ASN-OH · dl-glyceraldehyd · DL-GLYCERALDEHYDE
Identifikatoren & physikalische Daten
| CAS No. | 367-47-5 |
|---|---|
| Summenformel | C3H6O3 |
| Durchschnittliche Molmasse | 90,08 g/mol |
| Monoisotopische Masse | 90,03169405 g/mol |
| SMILES | O=CC(O)CO |
| InChIKey | MNQZXJOMYWMBOU-UHFFFAOYSA-N |
| PubChem CID | 751 |
| ChEMBL | CHEMBL173813 |
| ChEBI | CHEBI:5445 |
| EC No. | 200-290-0 |
| DTXSID | DTXSID90861586 |
| Lokaler Name | DL-Glyceraldehyd |
Chemische & physikalische Eigenschaften
| XLogP | -1,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 57,5 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 6 |
| Formalladung | 0 |
| Komplexität | 43,3 |
| Stoffklassen | Biological Agents -> Monosaccharides and Derivatives |
| Löslichkeit | 17 mg/mLMethanol (Slightly), Water (Slightly, Sonicated))29.13g/L(18 ºC) |
| Schmelzpunkt | 145 °C144-145 °C(lit.) |
| Physical Description | Solid[Merck Index] Off-white solid[Acros Organics MSDS] |
| Siedepunkt | 107.25°C (rough estimate) |
| Dichte | 1.593 g/cm3 (-5℃) |
| Brechungsindex | 1.4540 (estimate) |
| Lagerbedingungen | 2-8°C |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 12.60±0.20(Predicted) |
| Farbe | White to Off-White |
| Biologische Quelle | synthetic |
| InChI | InChI=1S/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2 |
| InChIKey | MNQZXJOMYWMBOU-UHFFFAOYSA-N |
| SMILES | C(=O)C(O)CO |
| CAS Datenbank | 56-82-6(CAS DataBase Reference) |
| EPA chemische Informationen | Glyceraldehyde (56-82-6) |
| CAS Number Unlabeled | 56-82-6 |
Sicherheit & Vorschriften
| Regulatorische Informationen | Chemical: Propanal, 2,3-dihydroxy-Propanal, 2,3-dihydroxy-: Does not have an individual approval but may be used under an appropriate group standard |
|---|---|
| Gefahrenübersicht | Intraperitoneal LD50 (rat) = 2,000 mg/kg[RTECS] May cause irritation[Acros Organics MSDS] |
| Carcinogen Classification | No indication of carcinogenicity to humans (not listed by IARC). |
| F | 10-23 |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29124990 |
| RTECS-Nr. | MA6475000 |
| Sicherheitshinweise (S) | 24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
DL-Glyceraldehyde has been used:as modifying reagent in the preparation of crystallization solution as a substrate to measure aldose reductase activityin the preparation of d/l-glyceraldehyde stock to determine the specific activity of GAPDH (glyceraldehyde 3-phosphate dehydrogenase)