HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N2-[(Phenylmethoxy)carbonyl]-L-lysin
Z-LYS-OH · CBZ-LYS-OH · CBZ-L-LYSINE · Z-L-LYS-OH · Cbz-L-Lys · CBZ-L-Lys-OH · Nα-Carbobenzoxy-L-lysine · (S)-6-AMino-2-(((benzyloxy)carbonyl)aMino)hexanoic acid
![Molekülstruktur von N2-[(Phenylmethoxy)carbonyl]-L-lysin](/img/chemical/75172.png)
Identifikatoren & physikalische Daten
| CAS No. | 2212-75-1 |
|---|---|
| Summenformel | C14H20N2O4 |
| Durchschnittliche Molmasse | 280,32 g/mol |
| Monoisotopische Masse | 280,14230712 g/mol |
| SMILES | NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChIKey | OJTJKAUNOLVMDX-LBPRGKRZSA-N |
| PubChem CID | 75172 |
| EC No. | 218-662-6 |
| DTXSID | DTXSID00883810 |
| Lokaler Name | N2-[(Phenylmethoxy)carbonyl]-L-lysin |
Chemische & physikalische Eigenschaften
| XLogP | -1,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 102 |
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 9 |
| Schwere Atome | 20 |
| Formalladung | 0 |
| Komplexität | 304 |
| Schmelzpunkt | 226-231 °C (dec.)(lit.) |
| Siedepunkt | 497.0±45.0 °C(Predicted) |
| Dichte | 1.206±0.06 g/cm3(Predicted) |
| Brechungsindex | 1,512 |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,Room temperature |
| Löslichkeit | Methanol (Slightly), Water (Slightly) |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 3.90±0.21(Predicted) |
| Farbe | White |
| BRN | 2153826 |
| Hauptanwendungen | peptide synthesis |
| InChI | 1S/C14H20N2O4/c15-9-5-4-8-12(13(17)18)16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | OJTJKAUNOLVMDX-LBPRGKRZSA-N |
| SMILES | NCCCC[C@H](NC(=O)OCc1ccccc1)C(O)=O |
| CAS Datenbank | 2212-75-1(CAS DataBase Reference) |
| EPA chemische Informationen | L-Lysine, N2-[(phenylmethoxy)carbonyl]- (2212-75-1) |
Sicherheit & Vorschriften
| GHS-Einstufung | Not Classified |
|---|---|
| Hazard Classes and Categories | Not Classified |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29242990 |
| R-Sätze (R) | 20/21/22-36/37/38 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 22-24/25-36-26 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
Educt for the convenient preparation of L-a-aminoadipic acid.