HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Naphthoylchlorid
SKL1321 · 2-Naphth · 2-NaphthoyL · 2-phthoyl chloride · 2-NAPTHOYL CHLORIDE · 2-NAPHTOYL CHLORIDE · 2-Naphthoic chloride · 2-NAPHTHOYL CHLORIDE
Identifikatoren & physikalische Daten
| CAS No. | 2243-83-6 |
|---|---|
| Summenformel | C11H7ClO |
| Durchschnittliche Molmasse | 190,62 g/mol |
| Monoisotopische Masse | 190,01854252 g/mol |
| SMILES | O=C(Cl)c1ccc2ccccc2c1 |
| InChIKey | XNLBCXGRQWUJLU-UHFFFAOYSA-N |
| PubChem CID | 75246 |
| EC No. | 218-822-5 |
| DTXSID | DTXSID3062287 |
| Lokaler Name | 2-Naphthoylchlorid |
Chemische & physikalische Eigenschaften
| XLogP | 4,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 17,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 202 |
| SpringerMaterials Properties | Chemical shift |
| Schmelzpunkt | 50-52 °C (lit.) |
| Siedepunkt | 160-162 °C/11 mmHg (lit.) |
| Dichte | 1.1664 (rough estimate) |
| Brechungsindex | 1.6530 (estimate) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| Löslichkeit | soluble in Toluene |
| Aggregatzustand | Crystalline Chunks |
| Farbe | Gray to brown |
| BRN | 907776 |
| InChI | InChI=1S/C11H7ClO/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| InChIKey | XNLBCXGRQWUJLU-UHFFFAOYSA-N |
| SMILES | C(Cl)(C1=CC=C2C(=C1)C=CC=C2)=O |
| CAS Datenbank | 2243-83-6(CAS DataBase Reference) |
| NIST chemische Informationen | 2-Naphthalenecarbonyl chloride(2243-83-6) |
| EPA chemische Informationen | 2-Naphthalenecarbonyl chloride (2243-83-6) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH290 (16.1%): May be corrosive to metals [Warning Corrosive to Metals]P234, P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P390, P405, P406, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 56 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | 2-Naphthoyl chloride: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Met. Corr. 1 (16.1%) |
| F | 10-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 3261 8/PG 2 |
| Zollcode | 29163900 |
| R-Sätze (R) | 34 |
| Gefahrensymbole | C |
| Sicherheitshinweise (S) | 26-36/37/39-45 |
| Gefahrenklasse | 8Skin Corr. 1B |
| Verpackungsgruppe | II |
| Lagerklasse | 8A - Combustible corrosive hazardous materials |
Anwendungen & Verwendung
Verwenden
2-Naphthoyl Chloride can be used for anticancer and antiinflammatory agents.