HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Chlor-4-fluorbenzoesure
MINA-008 · RARECHEM AL BO 0405 · TIMTEC-BB SBB003795 · 1-chloro-2-fluorobezene · 2-Chloro-4-Fluorobenzoic · Mefenamic Acid Impurity 61 · 2-Choro-4-fluorobenzoic acid · 2-chloro-4-fluorobenzioc acid
Identifikatoren & physikalische Daten
| CAS No. | 2252-51-9 |
|---|---|
| Summenformel | C7H4ClFO2 |
| Durchschnittliche Molmasse | 174,55 g/mol |
| Monoisotopische Masse | 173,9883852 g/mol |
| SMILES | O=C(O)c1ccc(F)cc1Cl |
| InChIKey | GRPWQLDSGNZEQE-UHFFFAOYSA-N |
| PubChem CID | 75259 |
| EC No. | 218-845-0 |
| DTXSID | DTXSID90177038 |
| Lokaler Name | 2-Chlor-4-fluorbenzoesure |
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 37,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 163 |
| Schmelzpunkt | 181-183 °C (lit.) |
| Siedepunkt | 271.9±20.0 °C(Predicted) |
| Dichte | 1.4016 (estimate) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | 95% ethanol: soluble50mg/mL, clear to very slightly hazy, colorless to very faintly yellow |
| pKa (Säurekonstante) | 2.90±0.25(Predicted) |
| Aggregatzustand | Powder or Flakes |
| Farbe | White |
| BRN | 1946215 |
| InChI | InChI=1S/C7H4ClFO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,(H,10,11) |
| InChIKey | GRPWQLDSGNZEQE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C=C1Cl |
| CAS Datenbank | 2252-51-9(CAS DataBase Reference) |
| NIST chemische Informationen | 2-Chloro-4-fluorobenzoic acid(2252-51-9) |
| EPA chemische Informationen | Benzoic acid, 2-chloro-4-fluoro- (2252-51-9) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29163990 |
| R-Sätze (R) | 22-37/38-41-36/37/38 |
| Gefahrensymbole | Xn,Xi |
| Sicherheitshinweise (S) | 26-36/37/39-37/39-36 |
| Gefahrenklasse | IRRITANTAcute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2-Chloro-4-fluorobenzoic acid was used in the preparation of 2-(2-chloro-4-fluorophenyl)-benzothiazole.