HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,3-Bis(chloromethyl)-1,1,3,3-tetramethyldisiloxane
DK689 · BIS(CHLOROMETHYL)TETRAMETHYLDISILOXANE · Tetramethylbis(chloromethyl)disiloxane · 1,3-BIS(CHLOROMETHYL)TETRAMETHYLDISILOXANE · 1,3-Di-(chloromethyl)-tetramethyldisiloxane · Tetramethyl-1,3-bis(chloromethyl)disiloxane · BIS(CHLOROMETHYL)-1,1,3,3-TETRAMETHYLDISILOXANE · 1,3-Dichloromethyl-1,1,3,3-Tetramethyl Disiloxane
Identifikatoren & physikalische Daten
| CAS No. | 2362-10-9 |
|---|---|
| Summenformel | C6H16Cl2OSi2 |
| Durchschnittliche Molmasse | 231,26 g/mol |
| Monoisotopische Masse | 230,01167355 g/mol |
| SMILES | C[Si](C)(CCl)O[Si](C)(C)CCl |
| InChIKey | NBGGEWGFZUDQKZ-UHFFFAOYSA-N |
| PubChem CID | 75385 |
| EC No. | 219-109-1 |
| DTXSID | DTXSID5062348 |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 9,2 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 114 |
| SpringerMaterials Properties | 29Si nuclear magnetic resonance spectrum |
| Schmelzpunkt | -90°C |
| Siedepunkt | 204 °C |
| Dichte | 1.05 |
| Brechungsindex | 1.439 |
| Flammpunkt | 73°C |
| Lagerbedingungen | Inert atmosphere,2-8°C |
| Aggregatzustand | liquid |
| Wichte | 1.05 |
| Farbe | Colorless to Almost colorless |
| Löslichkeit | Not miscible or difficult to mix with water. |
| BRN | 506631 |
| CAS Datenbank | 2362-10-9(CAS DataBase Reference) |
| NIST chemische Informationen | Disiloxane, 1,3-bis(chloromethyl)-1,1,3,3-tetramethyl-(2362-10-9) |
| EPA chemische Informationen | Disiloxane, 1,3-bis(chloromethyl)-1,1,3,3-tetramethyl- (2362-10-9) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH226 (79.2%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (79.2%) |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 1993 |
| Zollcode | 29319090 |
| R-Sätze (R) | 36/38-36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36/37/39-36 |
Anwendungen & Verwendung
Verwenden
1,3-Bis(chloromethyl)tetramethyldisiloxane is a useful bifunctional silylating agent.