HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3-Chlorophenyl isothiocyanate
1-Chloro-3-isothiocyanatobenzene · TIMTEC-BB SBB006588 · M-CHLOROPHENYL ISOTHIOCYANATE · 3-Chlorophenyl isothiocyanate · 3-Chlorophenyl isothiocyate, 98% · 3-Chlorophenylisothiocyanate,98% · 3-Chlorophenyl isothiocyanate 98% · Benzene, 1-chloro-3-isothiocyanato-
Identifikatoren & physikalische Daten
| CAS No. | 2392-68-9 |
|---|---|
| Summenformel | C7H4ClNS |
| Durchschnittliche Molmasse | 169,63 g/mol |
| Monoisotopische Masse | 168,975298 g/mol |
| SMILES | S=C=Nc1cccc(Cl)c1 |
| InChIKey | WGXCKFMVBAOIFH-UHFFFAOYSA-N |
| PubChem CID | 75449 |
| EC No. | 627-851-6 |
| DTXSID | DTXSID20178634 |
Chemische & physikalische Eigenschaften
| XLogP | 4,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 44,5 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 154 |
| Siedepunkt | 249-250 °C |
| Dichte | 1.292 |
| Brechungsindex | 1.658-1.66 |
| Flammpunkt | >110°C |
| Lagerbedingungen | 2-8°C, stored under nitrogen |
| Aggregatzustand | liquid |
| Wichte | 1.292 |
| Löslichkeit | 33.93mg/L(25 ºC) |
| BRN | 636856 |
| InChI | InChI=1S/C7H4ClNS/c8-6-2-1-3-7(4-6)9-5-10/h1-4H |
| InChIKey | WGXCKFMVBAOIFH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC(N=C=S)=C1 |
| CAS Datenbank | 2392-68-9(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| UN-Transportnummer | 2810 |
| Zollcode | 29309090 |
| RTECS-Nr. | NX8474500 |
| R-Sätze (R) | 42-36/37/38-23/24/25-20/21/22 |
| Gefahrensymbole | T,Xn |
| Sicherheitshinweise (S) | 45-36/37/39-26-37/39 |
| Gefahrenklasse | 8Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
Anwendungen & Verwendung
Verwenden
3-Chlorophenyl isothiocyanate has been used in the synthesis of:2-[(3-chlorophenyl)amino]naphtho[2,1-b]furo-5H-[3,2-d][1,3,4]thiadiazolo[3,2-i]pyrimidin-5-one(S)-N-[3-{N-(3-chlorophenyl)-4-(3-fluorophenyl)piperazine]-1-carbothioamido}-2-oxooxazolidin-5-yl)methyl]acetamide