HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
m-Terphenyl-2'-ol
[1,1':3',1''-Terphenyl]-2'-ol · 0/3/32 · 2,6-DiphenyL · m-terphenyl-2'-ol · 2,6-DIPHENYLPHENOL · [m-Terphenyl]-2'-ol · 2,6-Diphenylphenol>2'-HYDROXY-M-TERPHENYL · 2,6-Diphenylphenol,98%
Identifikatoren & physikalische Daten
| CAS No. | 2432-11-3 |
|---|---|
| Summenformel | C18H14O |
| Durchschnittliche Molmasse | 246,3 g/mol |
| Monoisotopische Masse | 246,10446507 g/mol |
| SMILES | Oc1c(-c2ccccc2)cccc1-c1ccccc1 |
| InChIKey | ATGFTMUSEPZNJD-UHFFFAOYSA-N |
| PubChem CID | 75512 |
| EC No. | 219-401-9 |
| DTXSID | DTXSID30947151 |
| Lokaler Name | m-Terphenyl-2'-ol |
Chemische & physikalische Eigenschaften
| XLogP | 4,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 20,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 19 |
| Formalladung | 0 |
| Komplexität | 237 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Schmelzpunkt | 101-103 °C (lit.) |
| Siedepunkt | 349.31°C (rough estimate) |
| Dichte | 1.0572 (rough estimate) |
| Brechungsindex | 1.4700 (estimate) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly) |
| Aggregatzustand | Crystals or Powder |
| pKa (Säurekonstante) | 10.02±0.10(Predicted) |
| Farbe | White to off-white |
| BRN | 2051224 |
| InChI | InChI=1S/C18H14O/c19-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h1-13,19H |
| InChIKey | ATGFTMUSEPZNJD-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC(C3=CC=CC=C3)=C2O)=CC=CC=C1 |
| CAS Datenbank | 2432-11-3(CAS DataBase Reference) |
| NIST chemische Informationen | 2,6-Diphenyl phenol(2432-11-3) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (29.6%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P273, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P391, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 152 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Status: Active Update: 15-06-2015 https://echa.europa.eu/registration-dossier/-/registered-dossier/12245 |
| Hazard Classes and Categories | Skin Irrit. 2 (29.6%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29071990 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36-37/39 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Aquatic Acute 1Aquatic Chronic 1 |
Anwendungen & Verwendung
Verwenden
2,6-Diphenylphenol has been used:as ligand during the synthesis of reduced coordination (less than 6), unchelated manganese oxygen cluster systemsin the preparation of derivatives of pyrazine-2,3-dicarbonitrile, precursor required for the synthesis of octaazaphthalocyanine (AzaPc) derivatives