HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Diisopropylazodicarboxylat
DIAD · Diisopropyl diazene-1,2-dicarboxylate · diisopropyl (E)-diazene-1,2-dicarboxylate · diisopropyl azodiformate · Disopropyl Azodicarboxylate · AZODICARBONIC ACID DIISOPROPYL ESTER · (E)-diisopropyl diazene-1,2-dicarboxylate · Diisopropyl azodicarboxylate [DIAD]
Identifikatoren & physikalische Daten
| CAS No. | 2446-83-5 |
|---|---|
| Summenformel | C8H14N2O4 |
| Durchschnittliche Molmasse | 202,21 g/mol |
| Monoisotopische Masse | 202,09535693 g/mol |
| SMILES | CC(C)OC(=O)N=NC(=O)OC(C)C |
| InChIKey | VVWRJUBEIPHGQF-UHFFFAOYSA-N |
| PubChem CID | 75555 |
| Lokaler Name | Diisopropylazodicarboxylat |
Chemische & physikalische Eigenschaften
| XLogP | 2,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 77,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 211 |
| Schmelzpunkt | 3-5 °C |
| Siedepunkt | 75 °C/0.25 mmHg (lit.) |
| Dichte | 1.027 g/mL at 25 °C (lit.) |
| Dampfdruck | 1.04 hPa (20 °C) |
| Brechungsindex | n20/D 1.420(lit.) |
| Flammpunkt | 223 °F |
| Lagerbedingungen | Store below +30°C. |
| Löslichkeit | Chloroform (Slightly), Ethyl Acetate (Slightly)insoluble |
| Aggregatzustand | Liquid |
| Farbe | Clear to slightly turbid yellow-orange to red |
| BRN | 1912326 |
| InChI | InChI=1S/C8H14N2O4/c1-5(2)13-7(11)9-10-8(12)14-6(3)4/h5-6H,1-4H3 |
| InChIKey | VVWRJUBEIPHGQF-UHFFFAOYSA-N |
| SMILES | N(C(OC(C)C)=O)=NC(OC(C)C)=O |
| CAS Datenbank | 2446-83-5(CAS DataBase Reference) |
Sicherheit & Vorschriften
| F | 4.10-8 |
|---|---|
| Wassergefährdungsklasse (WGK) | 1 |
| UN-Transportnummer | UN 3082 9/PG 3 |
| Zollcode | 29270000 |
| R-Sätze (R) | 36/38-51/53-5-43-36/37/38-11-48/20/22-40 |
| Gefahrensymbole | Xn,Xi,N,F |
| hazard_note | Harmful/Irritant |
| Sicherheitshinweise (S) | 36-61-47A-36/37/39-29-26-16-60-36/37 |
| Gefahrenklasse | 9Aquatic Chronic 2Carc. 2Eye Irrit. 2Skin Irrit. 2STOT RE 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
Diisopropyl Azodicarboxylate is an azodicarboxylic acid derivative used as a reagent in the production of many organic compounds. Diisopropyl Azodicarboxylate is commonly used as an oxidizer in Mitsun obu reactions and can also serve as a selective deprotectant of N-benzyl groups in the presence of other protecting groups.