Identifikatoren & physikalische Daten
| CAS No. | 37831-71-3 |
|---|
| Summenformel | C13H16N2 |
|---|
| Durchschnittliche Molmasse | 200,28 g/mol |
|---|
| Monoisotopische Masse | 200,13134851 g/mol |
|---|
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCN(C)C3 |
|---|
| InChIKey | NSDIVZYSCVJIFL-UHFFFAOYSA-N |
|---|
| PubChem CID | 757133 |
|---|
| ChEMBL | CHEMBL1330617 |
|---|
| DTXSID | DTXSID701207995 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|
| Polarare Oberfläche (TPSA) | 19 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 1 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 241 |
|---|
| Löslichkeit | >30 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von 2,3,4,9-Tetrahydro-2,6-dimethyl-1H-pyrido[3,4-b]indole](/img/chemical/757133.png)