HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N-Phenyl-4-(phenylazo)anilin
BENZENEAZODIPHENYLAMINE · 4-ANILINOAZOBENZENE · Nsc 74774 · 4-Azobenzeneaniline · 4-anilino-azobenzen · Azobenzene, 4-anilino- · P-PHENYLAZODIPHENYLAMINE · 4- phenazodiphenylamine
Identifikatoren & physikalische Daten
| CAS No. | 101-75-7 |
|---|---|
| Summenformel | C18H15N3 |
| Durchschnittliche Molmasse | 273,3 g/mol |
| Monoisotopische Masse | 273,12659748 g/mol |
| SMILES | c1ccc(N=Nc2ccc(Nc3ccccc3)cc2)cc1 |
| InChIKey | VXLFYNFOITWQPM-UHFFFAOYSA-N |
| PubChem CID | 7575 |
| EC No. | 202-972-3 |
| DTXSID | DTXSID1059238 |
| Lokaler Name | N-Phenyl-4-(phenylazo)anilin |
Chemische & physikalische Eigenschaften
| XLogP | 5,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 36,8 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 308 |
| Stoffklassen | Dyes -> Azo Dyes |
| Physical Description | Orange powder[Alfa Aesar MSDS] |
| Schmelzpunkt | 87-91 °C |
| Siedepunkt | 406.35°C (rough estimate) |
| Dichte | 1.0332 (rough estimate) |
| Brechungsindex | 1.5480 (estimate) |
| Lagerbedingungen | room temp |
| Löslichkeit | Solubility Insoluble in watersoluble in ethanol, methanol |
| pKa (Säurekonstante) | 0.42(at 25℃) |
| Aggregatzustand | Fine Crystalline Powder |
| Farbe | Orange |
| BRN | 749359 |
| Hauptanwendungen | Display device, nonlinear optial (NLO) material, photoresists, printing plates, lithographic plates, photosensitive materials, photography, markers |
| InChI | InChI=1S/C18H15N3/c1-3-7-15(8-4-1)19-16-11-13-18(14-12-16)21-20-17-9-5-2-6-10-17/h1-14,19H |
| InChIKey | VXLFYNFOITWQPM-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2)=CC=C(N=NC2=CC=CC=C2)C=C1 |
| CAS Datenbank | 101-75-7(CAS DataBase Reference) |
| EPA chemische Informationen | Benzenamine, N-phenyl-4-(phenylazo)- (101-75-7) |
Sicherheit & Vorschriften
| GHS-Einstufung | This chemical does not meet GHS hazard criteria for 9.8% (5 of 51) of reports.WarningH302 (11.8%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 51 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Gefahrenübersicht | Intravenous LD50 (mouse) = 56 mg/kg[RTECS] A skin and strong eye irritantHarmful by ingestion[Alfa Aesar MSDS] |
| Hazard Classes and Categories | Acute Tox. 4 (11.8%) |
| Wassergefährdungsklasse (WGK) | 1 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | 3234 |
| Zollcode | 29270000 |
| RTECS-Nr. | JK0185000 |
| R-Sätze (R) | 36/37/38 |
| Toxizität | LD50 ivn-mus: 56 mg/kg CSLNX* NX#03760 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Verwenden
4-(Phenylazo)diphenylamine is a soluble azo dye and stain. Dyes and metabolites.