HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Methylprop-2-en-1-ylamin
AKOS 91389 · METHALLYLAMINE · JACS-2878-14-0 · CH2=C(CH3)CH2NH2 · 2-METHYLALLYLAMINE · 2-Methylallylamine>2-Methylallylamine 98% · 2-Methylallylamine,97% · 2-Methyl allyl aMine HCl
Identifikatoren & physikalische Daten
| CAS No. | 2878-14-0 |
|---|---|
| Summenformel | C4H9N |
| Durchschnittliche Molmasse | 71,12 g/mol |
| Monoisotopische Masse | 71,07349929 g/mol |
| SMILES | C=C(C)CN |
| InChIKey | VXDHQYLFEYUMFY-UHFFFAOYSA-N |
| PubChem CID | 76141 |
| EC No. | 220-724-2 |
| DTXSID | DTXSID80182954 |
| Lokaler Name | 2-Methylprop-2-en-1-ylamin |
Chemische & physikalische Eigenschaften
| XLogP | 0,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 26 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 5 |
| Formalladung | 0 |
| Komplexität | 38,9 |
| Siedepunkt | 78 °C |
| Dichte | 0.78 |
| Brechungsindex | 1.429-1.432 |
| Flammpunkt | -28 °C |
| Lagerbedingungen | 0-6°C |
| Aggregatzustand | Liquid |
| pKa (Säurekonstante) | 9.45±0.29(Predicted) |
| Farbe | Clear colorless |
| InChI | InChI=1S/C4H9N/c1-4(2)3-5/h1,3,5H2,2H3 |
| InChIKey | VXDHQYLFEYUMFY-UHFFFAOYSA-N |
| SMILES | C(N)C(C)=C |
| NIST chemische Informationen | 2-Propen-1-amine, 2-methyl-(2878-14-0) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH225 (83.3%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P264, P264+P265, P270, P271, P280, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P303+P361+P353, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P363, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 6 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 2 (83.3%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | 1992 |
| Zollcode | 29211990 |
| R-Sätze (R) | 36/37/38-11-36-22 |
| Gefahrensymbole | Xi-F,F,Xi,C,Xn |
| hazard_note | Highly Flammable/Irritant |
| Sicherheitshinweise (S) | 37/39-26-16 |
| Gefahrenklasse | FLAMMABLE, CORROSIVEAcute Tox. 4 OralEye Irrit. 2 |
| Verpackungsgruppe | II |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2-Methylallylamine is an intermediate used in the synthesis of urea-containing FK506 binding protein inhibitors. It is also used to prepare benzothiazepine dioxides with HIV-1 protease inhibitory activities. It is dehydrogenated to methacrylonitrile over a silver catalyst. Copolymerization of methallylamine with acrylonitrile increases the affinity of polyacrylonitrile fibers for dyes.