HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-(4-Propylphenyl)ethan-1-on
4-N-PROPYLACETOPHENONE · NSC 172873 · 1-(4-Propylphenyl) · TIMTEC-BB SBB007807 · P-PROPYLACETOPHENONE · 4-PROPYLACETOPHENONE · 4'-Propylacetophenone · LABOTEST-BB LT00159020
Identifikatoren & physikalische Daten
| CAS No. | 2932-65-2 |
|---|---|
| Summenformel | C11H14O |
| Durchschnittliche Molmasse | 162,23 g/mol |
| Monoisotopische Masse | 162,10446507 g/mol |
| SMILES | CCCc1ccc(C(C)=O)cc1 |
| InChIKey | ZNBVIYMIVFKTIW-UHFFFAOYSA-N |
| PubChem CID | 76236 |
| EC No. | 220-903-5 |
| DTXSID | DTXSID50183559 |
| Lokaler Name | 1-(4-Propylphenyl)ethan-1-on |
Chemische & physikalische Eigenschaften
| XLogP | 3,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 17,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 143 |
| Siedepunkt | 123-125°C (15 mmHg) |
| Dichte | 0,98 g/cm3 |
| Brechungsindex | 1.5225 |
| Flammpunkt | 251-252°C |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | Chloroform, Methanol |
| Aggregatzustand | Clear Colourless Liquid |
| Farbe | Colorless to Orange to Green |
| Wichte | 0.98 |
| BRN | 1858604 |
| InChI | InChI=1S/C11H14O/c1-3-4-10-5-7-11(8-6-10)9(2)12/h5-8H,3-4H2,1-2H3 |
| InChIKey | ZNBVIYMIVFKTIW-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(CCC)C=C1)C |
| CAS Datenbank | 2932-65-2(CAS DataBase Reference) |
| NIST chemische Informationen | 4-N-Propylacetophenone(2932-65-2) |
Sicherheit & Vorschriften
| Zollcode | 29143990 |
|---|---|
| R-Sätze (R) | 22-36/37/38 |
| Gefahrensymbole | Xn,Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 23-26-36/37/39-24/25 |
Anwendungen & Verwendung
Verwenden
1-(4-Propylphenyl)ethan-1-one is a semivolatile compound found in waste landfill leachates , it is used as an intermediate in the preparation of STN liquid crystals for display devices.