HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluorheptylacrylat
2,2,3,3,4,4,5,5,6,6,7,7-DODECAFLUOROHEPTYL ACRYLATE · 1H,1H,7H-Dodecafluoroheptyl · DFHA · DAIKIN R-5610 · TRIHYDROPERFLUOROHEPTYL ACRYLATE · 1H,1H,7H-PERFLUOROHEPTYL ACRYLATE · 1H,1H,7H-Perfluoroheptylacrylate98% · 1H,1H,7H-Dodecafluoroheptyl acrylate
Identifikatoren & physikalische Daten
| CAS No. | 2993-85-3 |
|---|---|
| Summenformel | C10H6F12O2 |
| Durchschnittliche Molmasse | 386,13 g/mol |
| Monoisotopische Masse | 386,0176174 g/mol |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChIKey | QJEJDNMGOWJONG-UHFFFAOYSA-N |
| PubChem CID | 76340 |
| EC No. | 221-064-8 |
| DTXSID | DTXSID80184039 |
| Lokaler Name | 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluorheptylacrylat |
Chemische & physikalische Eigenschaften
| XLogP | 4,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 26,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 14 |
| Frei drehbare Bindungen | 9 |
| Schwere Atome | 24 |
| Formalladung | 0 |
| Komplexität | 484 |
| PFAS | PFAS -> Other/unspecifiedPFAS -> OECD Category |
| SpringerMaterials Properties | Surface tension |
| Siedepunkt | 197 °C (lit.) |
| Dichte | 1.581 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.342(lit.) |
| Flammpunkt | 215 °F |
| Lagerbedingungen | 2-8°C |
| Aggregatzustand | clear liquid |
| Farbe | Colorless to Almost colorless |
| Wichte | 1.581 |
| BRN | 3563773 |
| InChI | InChI=1S/C10H6F12O2/c1-2-4(23)24-3-6(13,14)8(17,18)10(21,22)9(19,20)7(15,16)5(11)12/h2,5H,1,3H2 |
| InChIKey | QJEJDNMGOWJONG-UHFFFAOYSA-N |
| SMILES | C(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)(=O)C=C |
| CAS Datenbank | 2993-85-3(CAS DataBase Reference) |
| EPA chemische Informationen | (6H-Perfluorohexyl)methyl acrylate (2993-85-3) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29161290 |
| RTECS-Nr. | UD3340500 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| hazard_note | Irritant/Keep Cold |
| Sicherheitshinweise (S) | 26-36 |
| Gefahrenklasse | 9Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
1H,1H,7H-Dodecafluoroheptyl Acrylate (CAS# 2993-85-3) is a polymerizable liquid crystal that can be used as an optically anisotropic film, optical film, polarizing plate, and image display device. It can also be used to produce particulate vinyliden-fluoride-based polymer.