Identifikatoren & physikalische Daten
| CAS No. | 3091-32-5 |
|---|
| Summenformel | C18H33ClSn |
|---|
| Durchschnittliche Molmasse | 403,6 g/mol |
|---|
| Monoisotopische Masse | 404,12927344 g/mol |
|---|
| SMILES | [Cl][Sn]([CH]1CCCCC1)([CH]1CCCCC1)[CH]1CCCCC1 |
|---|
| InChIKey | OJVZYIKTLISAIH-UHFFFAOYSA-M |
|---|
| PubChem CID | 76539 |
|---|
| EC No. | 221-437-5 |
|---|
| DTXSID | DTXSID5062845 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 0 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 0 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 20 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 240 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302: Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P271, P273, P280, P301+P317, P302+P352, P304+P340, P317, P321, P330, P362+P364, P391, and P501 (click each P-code to see the statement)H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%)Acute toxicity - category 4Acute Tox. 4 * |
|---|
