HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 7726257Erstellt: 2. November 2026
[2-[(2-Fluorophenyl)carbamoylamino]-2-oxoethyl] 2,4-dimethoxybenzoate
https://huagongshe.com/de/chemical/7726257
Identifikatoren & physikalische Daten
| CAS No. | 875661-16-8 |
|---|
| Summenformel | C18H17FN2O6 |
|---|
| Durchschnittliche Molmasse | 376,3 g/mol |
|---|
| Monoisotopische Masse | 376,10706443 g/mol |
|---|
| SMILES | COc1ccc(C(=O)OCC(=O)NC(=O)Nc2ccccc2F)c(OC)c1 |
|---|
| InChIKey | FYNVCKJSYXMMJX-UHFFFAOYSA-N |
|---|
| PubChem CID | 7726257 |
|---|
| ChEMBL | CHEMBL1708254 |
|---|
| DTXSID | DTXSID401325415 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,9 |
|---|
| Polarare Oberfläche (TPSA) | 103 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 7 |
|---|
| Frei drehbare Bindungen | 7 |
|---|
| Schwere Atome | 27 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 532 |
|---|
| Löslichkeit | 2.4 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von [2-[(2-Fluorophenyl)carbamoylamino]-2-oxoethyl] 2,4-dimethoxybenzoate](/img/chemical/7726257.png)