HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Tris(2-cyanethyl)phosphin
AURORA KA-1114 · Tri(2-cyanoethyl)phosphine · Tris-(2-cyanoethyl)phophine · Tris(2-cyanoethyl)phosphine · Tris(2-cyanoethyl)phosphine,94% · TCEPTris(2-cyanoethyl)phosphine · TCP Tris(2-cyanoethyl)phosphine · TRIS(2-CYANOETHYL)PHOSPHINE 92+%
Identifikatoren & physikalische Daten
| CAS No. | 4023-53-4 |
|---|---|
| Summenformel | C9H12N3P |
| Durchschnittliche Molmasse | 193,19 g/mol |
| Monoisotopische Masse | 193,07688439 g/mol |
| SMILES | N#CCCP(CCC#N)CCC#N |
| InChIKey | CHZAMJVESILJGH-UHFFFAOYSA-N |
| PubChem CID | 77639 |
| EC No. | 223-687-0 |
| DTXSID | DTXSID2063268 |
| Lokaler Name | Tris(2-cyanethyl)phosphin |
Chemische & physikalische Eigenschaften
| XLogP | -1 |
|---|---|
| Polarare Oberfläche (TPSA) | 71,4 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 223 |
| Schmelzpunkt | 97-98°C |
| Siedepunkt | 235°C 0,9mm |
| Flammpunkt | 235°C/0.9mm |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2-8°C |
| Aggregatzustand | crystal |
| Farbe | white |
| Löslichkeit | Soluble in DMSO, and DMF. Insoluble in water. |
| InChI | InChI=1S/C9H12N3P/c10-4-1-7-13(8-2-5-11)9-3-6-12/h1-3,7-9H2 |
| InChIKey | CHZAMJVESILJGH-UHFFFAOYSA-N |
| SMILES | P(CCC#N)(CCC#N)CCC#N |
| CAS Datenbank | 4023-53-4(CAS DataBase Reference) |
| EPA chemische Informationen | Propanenitrile, 3,3',3''-phosphinidynetris- (4023-53-4) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (71.4%): Toxic if swallowed [Danger Acute toxicity, oral]P203, P260, P261, P262, P264, P264+P265, P270, P271, P280, P284, P301+P316, P301+P317, P302+P352, P304+P340, P305+P351+P338, P316, P318, P319, P320, P321, P330, P332+P317, P337+P317, P361+P364, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 7 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (71.4%) |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN3464 |
| R-Sätze (R) | 20/21/22-36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 36/37/39-45-36-26 |
| Gefahrenklasse | 6.1 |
| Verpackungsgruppe | II |
Anwendungen & Verwendung
Verwenden
Tris(2-cyanoethyl)phosphine is used to produce 3,3',3''-phosphanetriyl-tri-propionic acid and hydrochloride by heating. It will need reagent conc. aq. HCl with reaction.