HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Toluol-p-sulfonsureanhydrid
4-Methylbenzenesulfonic anhydride · Tosic anhydride · p-Tolylsulfonyl 4-methylbenzenesulfonate · 4-TOLUENESULFONIC ANHYDRIDE · Toluene-p-anhydride · 3-Toluenesulfonicanhydride · p-Toluenesulfonyl anhydride · P-TOLUENESULFONIC ANHYDRIDE
Identifikatoren & physikalische Daten
| CAS No. | 4124-41-8 |
|---|---|
| Summenformel | C14H14O5S2 |
| Durchschnittliche Molmasse | 326,4 g/mol |
| Monoisotopische Masse | 326,02826555 g/mol |
| SMILES | Cc1ccc(S(=O)(=O)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChIKey | PDVFSPNIEOYOQL-UHFFFAOYSA-N |
| PubChem CID | 77773 |
| EC No. | 223-926-9 |
| DTXSID | DTXSID50194160 |
| Lokaler Name | Toluol-p-sulfonsureanhydrid |
Chemische & physikalische Eigenschaften
| XLogP | 3,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 94,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 475 |
| Schmelzpunkt | 121-127 °C(lit.) |
| Siedepunkt | 478.0±48.0 °C(Predicted) |
| Dichte | 1.361±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Inert atmosphere,2-8°C |
| Aggregatzustand | Powder, Crystals and/or Chunks |
| Farbe | Off-white to gray |
| BRN | 2223702 |
| InChI | 1S/C14H14O5S2/c1-11-3-7-13(8-4-11)20(15,16)19-21(17,18)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | PDVFSPNIEOYOQL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)S(=O)(=O)OS(=O)(=O)c2ccc(C)cc2 |
| CAS Datenbank | 4124-41-8(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 53 reports by companies from 6 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1C (100%) |
| F | 10-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2585 8/PG 3 |
| Zollcode | 29041000 |
| R-Sätze (R) | 34 |
| Gefahrensymbole | C |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 26-36/37/39-45 |
| Gefahrenklasse | 8Eye Dam. 1Skin Corr. 1B |
| Verpackungsgruppe | II |
| Lagerklasse | 8A - Combustible corrosive hazardous materials |
Anwendungen & Verwendung
Beschreibung
Toluol-4-sulfonsäureanhydrid bildet farblose, sehr feuchtigkeitsempfindliche Kristalle. Die Substanz besitzt nur wissenschaftliches Interesse.
Verwenden
p-Toluenesulfonic anhydride has been employed as reagent in palladium-catalyzed allylic alkenylation of allylic alcohols with n-butyl acrylate.