HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
ST012869
2-(2-Morpholinoethyl)isoindoline-1,3-dione · 1H-Isoindole-1,3(2H)-dione, 2-[2-(4-morpholinyl)ethyl]-
Identifikatoren & physikalische Daten
| CAS No. | 6820-90-2 |
|---|---|
| Summenformel | C14H16N2O3 |
| Durchschnittliche Molmasse | 260,29 g/mol |
| Monoisotopische Masse | 260,11609238 g/mol |
| SMILES | O=C1c2ccccc2C(=O)N1CCN1CCOCC1 |
| InChIKey | HZYIEFBIKQXUHA-UHFFFAOYSA-N |
| PubChem CID | 779502 |
| ChEMBL | CHEMBL1893667 |
| DTXSID | DTXSID10354703 |
Chemische & physikalische Eigenschaften
| XLogP | 1,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 49,9 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 19 |
| Formalladung | 0 |
| Komplexität | 342 |
| Löslichkeit | soluble in Chloroform, Dichloromethane, Ethy lAcetate |
| Aggregatzustand | Solid |
| Farbe | Light Yellow |
Anwendungen & Verwendung
Verwenden
N-(2-Morpholinoethyl)-phthalimide is an intermediate in the synthesis of Moclobemide-d8 which is the labeled analogue of Moclobemide (M481000), a reversible monoamine oxidase inhibitor.