Identifikatoren & physikalische Daten
| CAS No. | 90699-81-3 |
|---|
| Summenformel | C14H12N2OS |
|---|
| Durchschnittliche Molmasse | 256,32 g/mol |
|---|
| Monoisotopische Masse | 256,06703418 g/mol |
|---|
| SMILES | Cc1sc2ncn(-c3ccccc3)c(=O)c2c1C |
|---|
| InChIKey | PWKYJDFVCSHYKS-UHFFFAOYSA-N |
|---|
| PubChem CID | 780992 |
|---|
| ChEMBL | CHEMBL1426162 |
|---|
| DTXSID | DTXSID10354748 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,2 |
|---|
| Polarare Oberfläche (TPSA) | 60,9 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 18 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 365 |
|---|
| Löslichkeit | 5.6 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von Thieno[2,3-d]pyrimidin-4(3H)-one, 5,6-dimethyl-3-phenyl-](/img/chemical/780992.png)