HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,2',2''-[methylidyntris(oxy)]trispropan
TIPOF · TIPO · TRIISOPROPOXYMETHANE · Isopropyl orthoformate · Proformate triisopropyl · TRIISOPROPYL ORTHOFORMATE · Tri(2-propyl)orthoformate · TriisopropylOrthoformate>2-diisopropoxymethoxy-propane
![Molekülstruktur von 2,2',2''-[methylidyntris(oxy)]trispropan](/img/chemical/78191.png)
Identifikatoren & physikalische Daten
| CAS No. | 4447-60-3 |
|---|---|
| Summenformel | C10H22O3 |
| Durchschnittliche Molmasse | 190,28 g/mol |
| Monoisotopische Masse | 190,15689456 g/mol |
| SMILES | CC(C)OC(OC(C)C)OC(C)C |
| InChIKey | FPIVAWNGRDHRSQ-UHFFFAOYSA-N |
| PubChem CID | 78191 |
| EC No. | 224-688-9 |
| DTXSID | DTXSID7063479 |
| Lokaler Name | 2,2',2''-[methylidyntris(oxy)]trispropan |
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 27,7 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 97,6 |
| SpringerMaterials Properties | Optical coefficient |
| Siedepunkt | 65-66 °C/18 mmHg (lit.) |
| Dichte | 0.854 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.397(lit.) |
| Flammpunkt | 108 °F |
| Lagerbedingungen | Flammables area |
| Aggregatzustand | Liquid |
| Farbe | Clear colorless |
| BRN | 1700668 |
| InChI | InChI=1S/C10H22O3/c1-7(2)11-10(12-8(3)4)13-9(5)6/h7-10H,1-6H3 |
| InChIKey | FPIVAWNGRDHRSQ-UHFFFAOYSA-N |
| SMILES | C(OC(C)C)(OC(C)C)OC(C)C |
| CAS Datenbank | 4447-60-3(CAS DataBase Reference) |
| EPA chemische Informationen | Propane, 2,2',2''-[methylidynetris(oxy)]tris- (4447-60-3) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | PMN - indicates a commenced PMN (Pre-Manufacture Notices) substance.Propane, 2,2',2''-[methylidynetris(oxy)]tris-: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| F | 21 |
| Wassergefährdungsklasse (WGK) | 1 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 3272 3/PG 3 |
| Zollcode | 29159000 |
| R-Sätze (R) | 10-36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36-37/39-16 |
| Gefahrenklasse | 3Eye Irrit. 2Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
Triisopropyl Orthoformate (cas# 4447-60-3) is a compound useful in organic synthesis.