HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Brom-5-nitropyridin
NSC 73702 · 5-nitro-2- · TIMTEC-BB SBB003519 · 5-nitro-2-bromopyridin · 2-BROMO-5-NITROPYRIDINE · 2-BORMO-5-NITROPYRIDINE · 2-bromo-5-mitropyridine · 5-Nitro-2-broMopyridine
Identifikatoren & physikalische Daten
| CAS No. | 4487-59-6 |
|---|---|
| Summenformel | C5H3BrN2O2 |
| Durchschnittliche Molmasse | 202,99 g/mol |
| Monoisotopische Masse | 201,93778944 g/mol |
| SMILES | O=[N+]([O-])c1ccc(Br)nc1 |
| InChIKey | HUUFTVUBFFESEN-UHFFFAOYSA-N |
| PubChem CID | 78240 |
| EC No. | 224-777-2 |
| DTXSID | DTXSID10196327 |
| Lokaler Name | 2-Brom-5-nitropyridin |
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 58,7 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 136 |
| Schmelzpunkt | 139-141 °C (lit.) |
| Siedepunkt | 145-147 °C/10 mmHg (lit.) |
| Dichte | 1.8727 (rough estimate) |
| Brechungsindex | 1.6200 (estimate) |
| Flammpunkt | 145-147°C/10mm |
| Lagerbedingungen | Inert atmosphere,2-8°C |
| Löslichkeit | Chloroform, Hot MethanolInsoluble in water. |
| Aggregatzustand | Crystalline Powder |
| pKa (Säurekonstante) | -3.24±0.10(Predicted) |
| Farbe | Light yellow to light brown |
| BRN | 120901 |
| InChI | InChI=1S/C5H3BrN2O2/c6-5-2-1-4(3-7-5)8(9)10/h1-3H |
| InChIKey | HUUFTVUBFFESEN-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C([N+]([O-])=O)C=C1 |
| CAS Datenbank | 4487-59-6(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (88.9%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (88.9%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2811 6.1/PG 3 |
| Zollcode | 29333990 |
| R-Sätze (R) | 22-36/37/38-20/21/22 |
| Gefahrensymbole | Xn,Xi |
| hazard_note | Irritant/Keep Cold |
| Sicherheitshinweise (S) | 26-37/39-22-36 |
| Gefahrenklasse | IRRITANT, IRRITANT-HARMFULAcute Tox. 3 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
Anwendungen & Verwendung
Verwenden
2-Bromo-5-nitropyridine was used in preparation of boc-protected (piperazin-1-ylmethyl)biaryls via microwave-mediated Suzuki-Miyaura coupling with (boc-piperazin-1-ylmethyl)phenylboronic acid pinacol esters. It was also used in the synthesis of 2-pyridyl analogs. Substituted 5-nitro-2-ethynylpyridines were synthesized by the Sonogashira reaction of 2-bromo-5-5-nitropyridine with terminal acetylenes.