HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 788024Erstellt: 2. November 2026
4-amino-N-(3,4-dimethylphenyl)benzene-1-sulfonamide
BenzenesulfonaMide,4-aMino-N-(3,4-diMethylphenyl)- · 4-Amino-N-(3,4-dimethylphenyl)benzene-1-sulfonamide
https://huagongshe.com/de/chemical/788024
Identifikatoren & physikalische Daten
| CAS No. | 20555-67-3 |
|---|
| Summenformel | C14H16N2O2S |
|---|
| Durchschnittliche Molmasse | 276,36 g/mol |
|---|
| Monoisotopische Masse | 276,09324893 g/mol |
|---|
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(N)cc2)cc1C |
|---|
| InChIKey | DTALSVTYPBXLQL-UHFFFAOYSA-N |
|---|
| PubChem CID | 788024 |
|---|
| EC No. | 100-429-4 |
|---|
| DTXSID | DTXSID50354964 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,5 |
|---|
| Polarare Oberfläche (TPSA) | 80,6 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 383 |
|---|
| Schmelzpunkt | 169.5-171.1 °C(Solv: ethanol (64-17-5)water (7732-18-5)) |
|---|
| Siedepunkt | 465.6±55.0 °C(Predicted) |
|---|
| Dichte | 1.295±0.06 g/cm3(Predicted) |
|---|
| Lagerbedingungen | 2-8°C, protect from light |
|---|
| pKa (Säurekonstante) | 9.56±0.10(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
