HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Pentadecafluoroctylchlorid
PERFLUOROOCTANYL CHLORIDE · Perfluorocaprylic chloride · PERFLUOROOCTANOYL CHLORIDE · Xin chloride perfluorinated · n-Perfluorooctanoyl chloride · Perfluorooctanoylchloride97% · pentadecafluorooctyl chloride · Perfluorooctanoyl chloride 97%
Identifikatoren & physikalische Daten
| CAS No. | 335-64-8 |
|---|---|
| Summenformel | C8ClF15O |
| Durchschnittliche Molmasse | 432,51 g/mol |
| Monoisotopische Masse | 431,9398156 g/mol |
| SMILES | O=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChIKey | AQQBRCXWZZAFOK-UHFFFAOYSA-N |
| PubChem CID | 78978 |
| EC No. | 206-394-2 |
| DTXSID | DTXSID40187142 |
| Lokaler Name | Pentadecafluoroctylchlorid |
Chemische & physikalische Eigenschaften
| XLogP | 5,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 17,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 16 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 25 |
| Formalladung | 0 |
| Komplexität | 532 |
| PFAS | PFAS -> Other/unspecifiedPFAS -> OECD Category |
| Schmelzpunkt | 74-75 °C(Solv: benzene (71-43-2)) |
| Siedepunkt | 129-130 °C/744 mmHg (lit.) |
| Dichte | 1.744 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.3045(lit.) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | Store below +30°C. |
| Löslichkeit | Reacts with water. |
| BRN | 1809677 |
| InChI | 1S/C8ClF15O/c9-1(25)2(10,11)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)24 |
| InChIKey | AQQBRCXWZZAFOK-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(Cl)=O |
| CAS Datenbank | 335-64-8(CAS DataBase Reference) |
| NIST chemische Informationen | Perfluorooctanoyl chloride(335-64-8) |
| EPA chemische Informationen | Pentadecafluorooctyl chloride (335-64-8) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P264+P265, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 3265 8/PG 2 |
| Zollcode | 29159080 |
| R-Sätze (R) | 34 |
| Gefahrensymbole | C |
| hazard_note | Corrosive |
| Sicherheitshinweise (S) | 26-36/37/39-45 |
| Gefahrenklasse | 8Acute Tox. 4 InhalationAcute Tox. 4 OralCarc. 2Eye Dam. 1Lact.Repr. 1BSTOT RE 1 |
| Verpackungsgruppe | II |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
Anwendungen & Verwendung
Verwenden
Pentadecafluorooctanoyl chloride can be used:In the derivatization of poly(2-hydroxyethyl methacrylate) (PHEMA) via esterification for use as composite membranes.In the fabrication of superhydrophobic cellulose surfaces.As a reagent for the esterification of hydroxyl-functionalized gold nanocrystals.As a reagent in the synthesis of fluorous derivatives of diaminocyclohexane which are used as ligands.