HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,5-Dichlorbenzolsulfonylchlorid
2,5-Dichlorobenzene-1-sulfonyl chloride · 2,5-dichloro-benzenesulfonylchlorid · 2,5-Dichlorobenzenesulfonyl chloride · 2,5-DICHLOROBENZENESULPHONYL CHLORIDE · 2,5-DichlorobenzenesulfonylChloride>Benzenesulfonyl chloride, 2,5-dichloro- · 2,5-Dichlorobenzenesulphonyl chloride 98% · 2,5-DICHLOROBENZENESULFONYL CHLORIDE, 98 % · 2,5-Dichlorobenzenesulfonyl chloride, 98% 25GR
Identifikatoren & physikalische Daten
| CAS No. | 5402-73-3 |
|---|---|
| Summenformel | C6H3Cl3O2S |
| Durchschnittliche Molmasse | 245,5 g/mol |
| Monoisotopische Masse | 243,89193338 g/mol |
| SMILES | O=S(=O)(Cl)c1cc(Cl)ccc1Cl |
| InChIKey | BXCOSWRSIISQSL-UHFFFAOYSA-N |
| PubChem CID | 79401 |
| EC No. | 226-453-6 |
| DTXSID | DTXSID7063841 |
| Lokaler Name | 2,5-Dichlorbenzolsulfonylchlorid |
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|---|
| Polarare Oberfläche (TPSA) | 42,5 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 246 |
| Stoffklassen | Toxic Gases & Vapors -> Acid Halides |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| Physical Description | Off-white powdermp = 36-37 deg C[Alfa Aesar MSDS] |
| Schmelzpunkt | 36-37 °C(lit.) |
| Siedepunkt | 253°C (estimate) |
| Dichte | 1.608 (estimate) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| Löslichkeit | Chloroform, DMSO |
| Aggregatzustand | solid |
| Farbe | Off-White to Pale Beige |
| BRN | 2369410 |
| InChI | 1S/C6H3Cl3O2S/c7-4-1-2-5(8)6(3-4)12(9,10)11/h1-3H |
| InChIKey | BXCOSWRSIISQSL-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Cl)c(c1)S(Cl)(=O)=O |
| CAS Datenbank | 5402-73-3(CAS DataBase Reference) |
| EPA chemische Informationen | Benzenesulfonyl chloride, 2,5-dichloro- (5402-73-3) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P261, P264, P264+P265, P271, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P319, P321, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Gefahrenübersicht | Causes burnsInhalation may cause corrosive injuries to upper respiratory tract and lungs[Alfa Aesar MSDS] |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| Unerwünschte Wirkungen | Dermatotoxin - Skin burns. |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 3261 8/PG 2 |
| Zollcode | 29049090 |
| R-Sätze (R) | 34-36/37 |
| Gefahrensymbole | C |
| hazard_note | Corrosive |
| Sicherheitshinweise (S) | 26-27-28-36/37/39-45 |
| Gefahrenklasse | 8Eye Dam. 1Skin Corr. 1BSTOT SE 3 |
| Verpackungsgruppe | II |
| Lagerklasse | 8A - Combustible corrosive hazardous materials |
Anwendungen & Verwendung
Verwenden
2,5-Dichlorobenzenesulfonyl Chloride is used in the synthesis of sulfonamide derivatives that show antibacterial activity. It has been described as a modifier for Nylon 6.