HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Ethylbiphenyl
4-Ethyl-1,1'-biphenyl · Nsc 60063 · 4-ETHYLBIPHENYL · p-Ethylbiphenyl · Biphenyl, 4-ethyl- · 4-Ethylbiphenyl>4-Ethylbiphenyl,99% · 1’-Biphenyl,4-ethyl-1 · 1-Ethyl-4-phenylbenzene
Identifikatoren & physikalische Daten
| CAS No. | 5707-44-8 |
|---|---|
| Summenformel | C14H14 |
| Durchschnittliche Molmasse | 182,26 g/mol |
| Monoisotopische Masse | 182,10955045 g/mol |
| SMILES | CCc1ccc(-c2ccccc2)cc1 |
| InChIKey | SRQOBNUBCLPPPH-UHFFFAOYSA-N |
| PubChem CID | 79786 |
| EC No. | 679-980-2 |
| DTXSID | DTXSID7073355 |
Chemische & physikalische Eigenschaften
| XLogP | 5,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 147 |
| SpringerMaterials Properties | Chemical structure |
| Schmelzpunkt | 34-35.5°C |
| Siedepunkt | 149-149.8°C (12 mmHg) |
| Dichte | 0.9900 (estimate) |
| Brechungsindex | 1.5790 (estimate) |
| Flammpunkt | >110°C |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| BRN | 1904973 |
| InChI | InChI=1S/C14H14/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h3-11H,2H2,1H3 |
| InChIKey | SRQOBNUBCLPPPH-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(CC)C=C1 |
| CAS Datenbank | 5707-44-8(CAS DataBase Reference) |
| NIST chemische Informationen | 4-Ethylbiphenyl(5707-44-8) |
| EPA chemische Informationen | 1,1'-Biphenyl, 4-ethyl- (5707-44-8) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH400 (100%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard]P273, P391, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory.H302: Harmful if swallowed [Warning Acute toxicity, oral] |
|---|---|
| Hazard Classes and Categories | Aquatic Acute 1 (100%)Acute toxicity (Oral) - Category 4 |
| UN-Transportnummer | 3077 |
| Zollcode | 29029090 |
| Sicherheitshinweise (S) | 24/25 |
| Gefahrenklasse | 9 |
| Verpackungsgruppe | III |
Anwendungen & Verwendung
Verwenden
Intermediates of Liquid Crystals